Difference between revisions of "Long-linear-glucans"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MANNPGUANYLTRANGDP-RXN MANNPGUANYLTRANGDP-RXN] == * direction: ** REVERSIBLE * ec number: ** [http:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] == * smiles: ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] == |
− | * | + | * smiles: |
− | ** | + | ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O |
− | * | + | * common name: |
− | ** | + | ** dCTP |
+ | * inchi key: | ||
+ | ** InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J | ||
+ | * molecular weight: | ||
+ | ** 463.127 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2'-deoxycytidine-5'-triphosphate | ||
+ | ** deoxycytidine-triphosphate | ||
+ | ** deoxy-CTP | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-14198]] |
− | + | * [[DCTP-PYROPHOSPHATASE-RXN]] | |
− | * | + | * [[DCTCP]] |
− | + | * [[RME255]] | |
− | + | * [[DCTUP]] | |
− | + | * [[RXN-14216]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | * [[ | + | * [[ATDCD]] |
− | + | * [[DCDPKIN-RXN]] | |
− | == | + | * [[ATDCDm]] |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | |
− | * | + | |
− | * | + | |
== External links == | == External links == | ||
− | * | + | * CAS : 2056-98-6 |
− | ** [http:// | + | * PUBCHEM: |
− | * LIGAND- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244665 25244665] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * HMDB : HMDB00998 |
− | * | + | * LIGAND-CPD: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00458 C00458] |
− | * | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61481 61481] |
− | {{#set: | + | * BIGG : dctp |
− | {{#set: | + | {{#set: smiles=C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O}} |
− | {{#set: | + | {{#set: common name=dCTP}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J}} |
− | {{#set: | + | {{#set: molecular weight=463.127 }} |
− | {{#set: | + | {{#set: common name=2'-deoxycytidine-5'-triphosphate|deoxycytidine-triphosphate|deoxy-CTP}} |
+ | {{#set: consumed by=RXN-14198|DCTP-PYROPHOSPHATASE-RXN|DCTCP|RME255|DCTUP|RXN-14216}} | ||
+ | {{#set: produced by=ATDCD|DCDPKIN-RXN|ATDCDm}} |
Revision as of 16:01, 21 March 2018
Contents
Metabolite DCTP
- smiles:
- C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O
- common name:
- dCTP
- inchi key:
- InChIKey=RGWHQCVHVJXOKC-SHYZEUOFSA-J
- molecular weight:
- 463.127
- Synonym(s):
- 2'-deoxycytidine-5'-triphosphate
- deoxycytidine-triphosphate
- deoxy-CTP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP(OP(OP(=O)([O-])[O-])([O-])=O)([O-])=O" cannot be used as a page name in this wiki.