|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACETOLACTSYN-RXN ACETOLACTSYN-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYADENOSINE DEOXYADENOSINE] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** C(O)C1(OC(CC(O)1)N3(C=NC2(=C(N)N=CN=C23))) |
| * common name: | | * common name: |
− | ** Acetolactate synthase catalytic subunit, mitochondrial | + | ** 2'-deoxyadenosine |
− | * ec number: | + | * inchi key: |
− | ** [http://enzyme.expasy.org/EC/2.2.1.6 EC-2.2.1.6] | + | ** InChIKey=OLXZPDWKRNYJJZ-RRKCRQDMSA-N |
| + | * molecular weight: |
| + | ** 251.244 |
| * Synonym(s): | | * Synonym(s): |
| + | ** deoxyadenosine |
| + | ** 2-deoxy-adenosine |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[DAD2PT]] |
− | ** 1 [[PROTON]][c] '''+''' 2 [[PYRUVATE]][c] '''=>''' 1 [[2-ACETO-LACTATE]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
| + | * [[ADDALT-RXN]] |
− | * With common name(s):
| + | == Reaction(s) known to produce the compound == |
− | ** 1 H+[c] '''+''' 2 pyruvate[c] '''=>''' 1 (S)-2-acetolactate[c] '''+''' 1 CO2[c]
| + | == Reaction(s) of unknown directionality == |
− | | + | * [[DAMPH]] |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_11362]] | + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | == Pathways ==
| + | |
− | * [[VALSYN-PWY]], L-valine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=VALSYN-PWY VALSYN-PWY] | + | |
− | ** '''4''' reactions found over '''4''' reactions in the full pathway
| + | |
− | * [[PWY-7111]], pyruvate fermentation to isobutanol (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7111 PWY-7111]
| + | |
− | ** '''4''' reactions found over '''5''' reactions in the full pathway
| + | |
− | * [[PWY-6389]], (S)-acetoin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6389 PWY-6389]
| + | |
− | ** '''2''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[PWY-5938]], (R)-acetoin biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5938 PWY-5938]
| + | |
− | ** '''2''' reactions found over '''3''' reactions in the full pathway
| + | |
− | * [[PWY-5939]], (R)-acetoin biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5939 PWY-5939]
| + | |
− | ** '''1''' reactions found over '''2''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * Category: [[manual]] | + | |
− | ** Source: [[manual-primary_network]]
| + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * CAS : 958-09-8 |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20504 20504] | + | * BIGG : dad_2 |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25249 25249] | + | * PUBCHEM: |
− | * LIGAND-RXN: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=13730 13730] |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00226 R00226] | + | * HMDB : HMDB00101 |
− | * UNIPROT: | + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/Q59950 Q59950] | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00559 C00559] |
− | ** [http://www.uniprot.org/uniprot/P42463 P42463]
| + | * CHEMSPIDER: |
− | ** [http://www.uniprot.org/uniprot/Q8XAV3 Q8XAV3] | + | ** [http://www.chemspider.com/Chemical-Structure.13135.html 13135] |
− | ** [http://www.uniprot.org/uniprot/P27868 P27868] | + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/P45260 P45260]
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17256 17256] |
− | ** [http://www.uniprot.org/uniprot/Q57625 Q57625]
| + | * METABOLIGHTS : MTBLC17256 |
− | ** [http://www.uniprot.org/uniprot/P37251 P37251] | + | {{#set: smiles=C(O)C1(OC(CC(O)1)N3(C=NC2(=C(N)N=CN=C23)))}} |
− | ** [http://www.uniprot.org/uniprot/P45261 P45261]
| + | {{#set: common name=2'-deoxyadenosine}} |
− | ** [http://www.uniprot.org/uniprot/O27493 O27493]
| + | {{#set: inchi key=InChIKey=OLXZPDWKRNYJJZ-RRKCRQDMSA-N}} |
− | ** [http://www.uniprot.org/uniprot/O66759 O66759]
| + | {{#set: molecular weight=251.244 }} |
− | ** [http://www.uniprot.org/uniprot/Q9PHU2 Q9PHU2]
| + | {{#set: common name=deoxyadenosine|2-deoxy-adenosine}} |
− | ** [http://www.uniprot.org/uniprot/O05031 O05031]
| + | {{#set: consumed by=DAD2PT|ADDALT-RXN}} |
− | ** [http://www.uniprot.org/uniprot/Q57725 Q57725]
| + | {{#set: reversible reaction associated=DAMPH}} |
− | ** [http://www.uniprot.org/uniprot/Q9PHU1 Q9PHU1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JTI1 Q9JTI1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q58077 Q58077]
| + | |
− | ** [http://www.uniprot.org/uniprot/O28554 O28554]
| + | |
− | ** [http://www.uniprot.org/uniprot/O53554 O53554]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q04789 Q04789]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JRF4 Q9JRF4]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59272 Q59272]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27696 P27696]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59498 Q59498]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9RFQ7 Q9RFQ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q05767 Q05767]
| + | |
− | ** [http://www.uniprot.org/uniprot/P40811 P40811]
| + | |
− | ** [http://www.uniprot.org/uniprot/P21622 P21622]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27818 P27818]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41768 Q41768]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q41769 Q41769]
| + | |
− | ** [http://www.uniprot.org/uniprot/P69684 P69684]
| + | |
− | ** [http://www.uniprot.org/uniprot/P27819 P27819]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9R586 Q9R586]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q02137 Q02137]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q02140 Q02140]
| + | |
− | ** [http://www.uniprot.org/uniprot/P36620 P36620]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42767 Q42767]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42768 Q42768]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q49865 Q49865]
| + | |
− | ** [http://www.uniprot.org/uniprot/O22547 O22547]
| + | |
− | ** [http://www.uniprot.org/uniprot/O49229 O49229]
| + | |
− | ** [http://www.uniprot.org/uniprot/O22578 O22578]
| + | |
− | ** [http://www.uniprot.org/uniprot/O49210 O49210]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q60021 Q60021]
| + | |
− | ** [http://www.uniprot.org/uniprot/P07342 P07342]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00892 P00892]
| + | |
− | ** [http://www.uniprot.org/uniprot/P08142 P08142]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0ADF8 P0ADF8]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00894 P00894]
| + | |
− | ** [http://www.uniprot.org/uniprot/P00893 P00893]
| + | |
− | ** [http://www.uniprot.org/uniprot/P17597 P17597]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09342 P09342]
| + | |
− | ** [http://www.uniprot.org/uniprot/P09114 P09114]
| + | |
− | ** [http://www.uniprot.org/uniprot/P14874 P14874]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | |
− | {{#set: common name=Acetolactate synthase catalytic subunit, mitochondrial}} | + | |
− | {{#set: ec number=EC-2.2.1.6}} | + | |
− | {{#set: gene associated=Tiso_gene_11362}} | + | |
− | {{#set: in pathway=VALSYN-PWY|PWY-7111|PWY-6389|PWY-5938|PWY-5939}} | + | |
− | {{#set: reconstruction category=manual|annotation}} | + | |
− | {{#set: reconstruction source=manual-primary_network|annotation-experimental_annotation}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}} | + | |