Difference between revisions of "Tiso gene 7126"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATAM ATAM] == * direction: ** LEFT-TO-RIGHT * common name: ** ATP:AMP phosphotransferase * Synonym(...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17373 CPD-17373] == * smiles: ** C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP(...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ATAM ATAM] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17373 CPD-17373] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP([O-])(=O)[O-])=O
 
* common name:
 
* common name:
−
** ATP:AMP phosphotransferase
+
** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate
 +
* inchi key:
 +
** InChIKey=ZXBGEIHFXPHRJY-NKFDZXFUSA-L
 +
* molecular weight:
 +
** 728.942   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-16121]]
−
** 1.0 [[AMP]][c] '''+''' 1.0 [[ATP]][c] '''=>''' 2.0 [[ADP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-16118]]
−
** 1.0 AMP[c] '''+''' 1.0 ATP[c] '''=>''' 2.0 ADP[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_5837]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[Tiso_gene_5839]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[Tiso_gene_805]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=ATP:AMP phosphotransferase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819824 91819824]
−
{{#set: gene associated=Tiso_gene_5837|Tiso_gene_5839|Tiso_gene_805}}
+
{{#set: smiles=C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP([O-])(=O)[O-])=O}}
−
{{#set: in pathway=}}
+
{{#set: common name=1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: inchi key=InChIKey=ZXBGEIHFXPHRJY-NKFDZXFUSA-L}}
−
{{#set: reconstruction source=orthology-creinhardtii}}
+
{{#set: molecular weight=728.942    }}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: consumed by=RXN-16121}}
 +
{{#set: produced by=RXN-16118}}

Revision as of 16:02, 21 March 2018

Metabolite CPD-17373

  • smiles:
    • C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP([O-])(=O)[O-])=O
  • common name:
    • 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate
  • inchi key:
    • InChIKey=ZXBGEIHFXPHRJY-NKFDZXFUSA-L
  • molecular weight:
    • 728.942
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP([O-])(=O)[O-])=O" cannot be used as a page name in this wiki.
"1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_7126&oldid=38269"