Difference between revisions of "R02984"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=QUINOPRIBOTRANS-RXN QUINOPRIBOTRANS-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** endo-_-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOEUCALENOL CYCLOEUCALENOL] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYCLOEUCALENOL CYCLOEUCALENOL] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)C(O)CCC2(CC12CCC(C)34)5)))) |
* common name: | * common name: | ||
− | ** | + | ** cycloeucalenol |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=HUNLTIZKNQDZEI-ZKZKKXEQSA-N |
− | * | + | * molecular weight: |
− | ** | + | ** 426.724 |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[CYCLOEUCALENOL-CYCLOISOMERASE-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CAS : 469-39-6 |
− | + | * PUBCHEM: | |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515311 102515311] | |
− | + | * CHEBI: | |
− | * | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16653 16653] |
− | ** [http:// | + | * LIGAND-CPD: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02141 C02141] | |
− | * | + | {{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)C(O)CCC2(CC12CCC(C)34)5))))}} |
− | ** [http://www. | + | {{#set: common name=cycloeucalenol}} |
− | * | + | {{#set: inchi key=InChIKey=HUNLTIZKNQDZEI-ZKZKKXEQSA-N}} |
− | ** [http://www. | + | {{#set: molecular weight=426.724 }} |
− | {{#set: | + | {{#set: consumed by=CYCLOEUCALENOL-CYCLOISOMERASE-RXN}} |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 16:02, 21 March 2018
Contents
Metabolite CYCLOEUCALENOL
- smiles:
- CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)C(O)CCC2(CC12CCC(C)34)5))))
- common name:
- cycloeucalenol
- inchi key:
- InChIKey=HUNLTIZKNQDZEI-ZKZKKXEQSA-N
- molecular weight:
- 426.724
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)C(O)CCC2(CC12CCC(C)34)5))))" cannot be used as a page name in this wiki.