Difference between revisions of "AGK"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14883 RXN-14883] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ide...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7424 CPD-7424] == * smiles: ** CC(C=CC=C(C)[CH]=C=C1(C(O)(C)CC(O)CC(C)(C)1))=CC=CC=C(C)C=CC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7424 CPD-7424] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C=CC=C(C)[CH]=C=C1(C(O)(C)CC(O)CC(C)(C)1))=CC=CC=C(C)C=CC=C(C)C=CC23(C(C)(C)CC(O)CC(C)(O2)3) |
+ | * common name: | ||
+ | ** 9'-cis-neoxanthin | ||
+ | * inchi key: | ||
+ | ** InChIKey=PGYAYSRVSAJXTE-OQASCVKESA-N | ||
+ | * molecular weight: | ||
+ | ** 600.88 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 9cNeox | ||
+ | ** 9c-neoxanthin | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-698]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5282217 5282217] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.10392237.html 10392237] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35306 35306] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C13431 C13431] | ||
+ | {{#set: smiles=CC(C=CC=C(C)[CH]=C=C1(C(O)(C)CC(O)CC(C)(C)1))=CC=CC=C(C)C=CC=C(C)C=CC23(C(C)(C)CC(O)CC(C)(O2)3)}} | ||
+ | {{#set: common name=9'-cis-neoxanthin}} | ||
+ | {{#set: inchi key=InChIKey=PGYAYSRVSAJXTE-OQASCVKESA-N}} | ||
+ | {{#set: molecular weight=600.88 }} | ||
+ | {{#set: common name=9cNeox|9c-neoxanthin}} | ||
+ | {{#set: consumed by=RXN-698}} |
Revision as of 16:02, 21 March 2018
Contents
Metabolite CPD-7424
- smiles:
- CC(C=CC=C(C)[CH]=C=C1(C(O)(C)CC(O)CC(C)(C)1))=CC=CC=C(C)C=CC=C(C)C=CC23(C(C)(C)CC(O)CC(C)(O2)3)
- common name:
- 9'-cis-neoxanthin
- inchi key:
- InChIKey=PGYAYSRVSAJXTE-OQASCVKESA-N
- molecular weight:
- 600.88
- Synonym(s):
- 9cNeox
- 9c-neoxanthin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C=CC=C(C)[CH]=C=C1(C(O)(C)CC(O)CC(C)(C)1))=CC=CC=C(C)C=CC=C(C)C=CC23(C(C)(C)CC(O)CC(C)(O2)3)" cannot be used as a page name in this wiki.