Difference between revisions of "CPDQT-37"

Revision as of 16:04, 21 March 2018

"C(NC(N)=[N+])CCC(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)[O-" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene Tiso_gene_15544 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19205 CPD-19205] ==
-* left end position:
+* smiles:
-** 3597
+** C(NC(N)=[N+])CCC(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)[O-]
-* transcription direction:
+* common name:
-** POSITIVE
+** L-4-hydroxyphenylglycine-L-arginine
-* right end position:
+* inchi key:
-** 4536
+** InChIKey=YGJWDZHQJBXRDU-QWRGUYRKSA-O
-* centisome position:
+* molecular weight:
-** 72.35969
+** 324.359
 * Synonym(s):
+** L-pHPG-L-Arg
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
+== Reaction(s) known to produce the compound ==
-** in-silico_annotation
+* [[RXN-17832]]
-***ec-number
+== Reaction(s) of unknown directionality ==
-== Pathways associated ==
 == External links  ==
-{{#set: left end position=3597}}
+{{#set: smiles=C(NC(N)=[N+])CCC(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)[O-]}}
-{{#set: transcription direction=POSITIVE}}
+{{#set: common name=L-4-hydroxyphenylglycine-L-arginine}}
-{{#set: right end position=4536}}
+{{#set: inchi key=InChIKey=YGJWDZHQJBXRDU-QWRGUYRKSA-O}}
-{{#set: centisome position=72.35969    }}
+{{#set: molecular weight=324.359    }}
-{{#set: reaction associated=DNA-DIRECTED-RNA-POLYMERASE-RXN}}
+{{#set: common name=L-pHPG-L-Arg}}
+{{#set: produced by=RXN-17832}}