Difference between revisions of "Tiso gene 2578"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_11754 == * left end position: ** 583 * transcription direction: ** NEGATIVE * right end position: ** 1959 * centisome position: ** 7.716743...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-707 CPD-707] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_11754 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-707 CPD-707] ==
−
* left end position:
+
* smiles:
−
** 583
+
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
−
* transcription direction:
+
* common name:
−
** NEGATIVE
+
** campesterol
−
* right end position:
+
* inchi key:
−
** 1959
+
** InChIKey=SGNBVLSWZMBQTH-PODYLUTMSA-N
−
* centisome position:
+
* molecular weight:
−
** 7.7167435    
+
** 400.687    
 
* Synonym(s):
 
* Synonym(s):
 +
** cholest 5-en-3-ol, 24-methyl
 +
** ergost-5-en-3β-ol, (24R)-
 +
** (24R)-24-methylcholest-5-en-3β-ol
 +
** 24(R)-methylcholesterol
 +
** campesterin
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[3.6.3.50-RXN]]
+
* [[RXN-4225]]
−
** [[pantograph]]-[[esiliculosus]]
+
== Reaction(s) known to produce the compound ==
−
* [[ATPASE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** [[pantograph]]-[[athaliana]]
+
−
* [[ATPSYN-RXN]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
** experimental_annotation
+
−
***ec-number
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways associated ==
+
−
* [[PWY-7219]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=583}}
+
* LIPID_MAPS : LMST01030097
−
{{#set: transcription direction=NEGATIVE}}
+
* PUBCHEM:
−
{{#set: right end position=1959}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=173183 173183]
−
{{#set: centisome position=7.7167435   }}
+
* HMDB : HMDB02869
−
{{#set: reaction associated=3.6.3.50-RXN|ATPASE-RXN|ATPSYN-RXN}}
+
* LIGAND-CPD:
−
{{#set: pathway associated=PWY-7219}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01789 C01789]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.10469749.html 10469749]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28623 28623]
 +
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: common name=campesterol}}
 +
{{#set: inchi key=InChIKey=SGNBVLSWZMBQTH-PODYLUTMSA-N}}
 +
{{#set: molecular weight=400.687   }}
 +
{{#set: common name=cholest 5-en-3-ol, 24-methyl|ergost-5-en-3β-ol, (24R)-|(24R)-24-methylcholest-5-en-3β-ol|24(R)-methylcholesterol|campesterin}}
 +
{{#set: consumed by=RXN-4225}}

Revision as of 16:04, 21 March 2018

Metabolite CPD-707

  • smiles:
    • CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • campesterol
  • inchi key:
    • InChIKey=SGNBVLSWZMBQTH-PODYLUTMSA-N
  • molecular weight:
    • 400.687
  • Synonym(s):
    • cholest 5-en-3-ol, 24-methyl
    • ergost-5-en-3β-ol, (24R)-
    • (24R)-24-methylcholest-5-en-3β-ol
    • 24(R)-methylcholesterol
    • campesterin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_2578&oldid=38599"