Difference between revisions of "ACETYL-GLU"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7580 RXN-7580] == * direction: ** LEFT-TO-RIGHT * common name: ** ent-kaurenal 19-hydroxylase *...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7004 CPD-7004] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7580 RXN-7580] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7004 CPD-7004] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
 
* common name:
 
* common name:
−
** ent-kaurenal 19-hydroxylase
+
** dihydrogeranylgeranyl chlorophyll a
 +
* inchi key:
 +
** InChIKey=QHUCPLMRABCZRD-USXFXJNZSA-M
 +
* molecular weight:
 +
** 888.463   
 
* Synonym(s):
 
* Synonym(s):
 +
** dihydrogeranylgeranyl-chl a
 +
** dihydroGG-chl a
 +
** dihydroGG-chlorophyll a
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-7665]]
−
** 1 [[NADPH]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[ENT-KAUR-16-EN-19-AL]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[CPD1F-132]][c] '''+''' 1 [[NADP]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-7664]]
−
** 1 NADPH[c] '''+''' 1 oxygen[c] '''+''' 1 ent-kaurenal[c] '''=>''' 1 H2O[c] '''+''' 1 ent-kaur-16-en-19-oate[c] '''+''' 1 NADP+[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_8263]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
* [[Tiso_gene_1547]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
== Pathways  ==
+
−
* [[PWY-5047]], gibberellin biosynthesis IV (Gibberella fujikuroi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5047 PWY-5047]
+
−
** '''6''' reactions found over '''15''' reactions in the full pathway
+
−
* [[PWY-5034]], GA12 biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5034 PWY-5034]
+
−
** '''6''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-athaliana]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10931 10931]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926294 46926294]
−
* LIGAND-RXN:
+
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R06293 R06293]
+
{{#set: common name=dihydrogeranylgeranyl chlorophyll a}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: inchi key=InChIKey=QHUCPLMRABCZRD-USXFXJNZSA-M}}
−
{{#set: common name=ent-kaurenal 19-hydroxylase}}
+
{{#set: molecular weight=888.463    }}
−
{{#set: gene associated=Tiso_gene_8263|Tiso_gene_1547}}
+
{{#set: common name=dihydrogeranylgeranyl-chl a|dihydroGG-chl a|dihydroGG-chlorophyll a}}
−
{{#set: in pathway=PWY-5047|PWY-5034}}
+
{{#set: consumed by=RXN-7665}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: produced by=RXN-7664}}
−
{{#set: reconstruction source=orthology-athaliana}}
+
−
{{#set: reconstruction tool=pantograph}}
+

Revision as of 17:05, 21 March 2018

Metabolite CPD-7004

  • smiles:
    • C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
  • common name:
    • dihydrogeranylgeranyl chlorophyll a
  • inchi key:
    • InChIKey=QHUCPLMRABCZRD-USXFXJNZSA-M
  • molecular weight:
    • 888.463
  • Synonym(s):
    • dihydrogeranylgeranyl-chl a
    • dihydroGG-chl a
    • dihydroGG-chlorophyll a

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C(C)C)C5(=[N+]([Mg--]36([N+]1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ACETYL-GLU&oldid=38648"