Difference between revisions of "CPD-12980"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_12647 == * Synonym(s): == Reactions associated == * 2.3.2.15-RXN ** pantograph-esiliculosus == Pathways associated == * PWY-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17346 CPD-17346] == * smiles: ** CCCCCC=CCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17346 CPD-17346] == |
+ | * smiles: | ||
+ | ** CCCCCC=CCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
+ | * common name: | ||
+ | ** 3-oxo-(11Z,14Z)-icosa-11,14-dienoyl-CoA | ||
+ | * inchi key: | ||
+ | ** InChIKey=PUWDUOCPCWFEFG-YGYQDCEASA-J | ||
+ | * molecular weight: | ||
+ | ** 1067.974 | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-16095]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | * [[RXN-16094]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581045 71581045] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74012 74012] | ||
+ | {{#set: smiles=CCCCCC=CCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
+ | {{#set: common name=3-oxo-(11Z,14Z)-icosa-11,14-dienoyl-CoA}} | ||
+ | {{#set: inchi key=InChIKey=PUWDUOCPCWFEFG-YGYQDCEASA-J}} | ||
+ | {{#set: molecular weight=1067.974 }} | ||
+ | {{#set: consumed by=RXN-16095}} | ||
+ | {{#set: produced by=RXN-16094}} |
Revision as of 17:06, 21 March 2018
Contents
Metabolite CPD-17346
- smiles:
- CCCCCC=CCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- 3-oxo-(11Z,14Z)-icosa-11,14-dienoyl-CoA
- inchi key:
- InChIKey=PUWDUOCPCWFEFG-YGYQDCEASA-J
- molecular weight:
- 1067.974
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC=CCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.