Difference between revisions of "Tiso gene 2190"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9843 RXN-9843] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With id...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11526 CPD-11526] == * smiles: ** CCC=CCC4(C(=O)CCC(CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11526 CPD-11526] == |
− | * | + | * smiles: |
− | ** | + | ** CCC=CCC4(C(=O)CCC(CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4) |
+ | * common name: | ||
+ | ** OPC4-trans-2-enoyl-CoA | ||
+ | * inchi key: | ||
+ | ** InChIKey=QSAQFDYWYNLXEC-RBHATRMTSA-J | ||
+ | * molecular weight: | ||
+ | ** 981.797 | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-10705]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-10707]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237329 44237329] |
− | {{#set: | + | {{#set: smiles=CCC=CCC4(C(=O)CCC(CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)}} |
− | {{#set: | + | {{#set: common name=OPC4-trans-2-enoyl-CoA}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=QSAQFDYWYNLXEC-RBHATRMTSA-J}} |
− | {{#set: | + | {{#set: molecular weight=981.797 }} |
− | {{#set: | + | {{#set: consumed by=RXN-10705}} |
− | {{#set: | + | {{#set: produced by=RXN-10707}} |
Revision as of 16:06, 21 March 2018
Contents
Metabolite CPD-11526
- smiles:
- CCC=CCC4(C(=O)CCC(CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
- common name:
- OPC4-trans-2-enoyl-CoA
- inchi key:
- InChIKey=QSAQFDYWYNLXEC-RBHATRMTSA-J
- molecular weight:
- 981.797
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCC=CCC4(C(=O)CCC(CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)" cannot be used as a page name in this wiki.