Difference between revisions of "Tiso gene 2190"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9843 RXN-9843] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With id...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11526 CPD-11526] == * smiles: ** CCC=CCC4(C(=O)CCC(CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9843 RXN-9843] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11526 CPD-11526] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCC=CCC4(C(=O)CCC(CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
 +
* common name:
 +
** OPC4-trans-2-enoyl-CoA
 +
* inchi key:
 +
** InChIKey=QSAQFDYWYNLXEC-RBHATRMTSA-J
 +
* molecular weight:
 +
** 981.797   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-10705]]
−
** 2 [[PROTON]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[Reduced-adrenal-ferredoxins]][c] '''+''' 1 [[CPD-10586]][c] '''=>''' 1 [[CPD-10587]][c] '''+''' 2 [[Oxidized-adrenal-ferredoxins]][c] '''+''' 2 [[WATER]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-10707]]
−
** 2 H+[c] '''+''' 1 oxygen[c] '''+''' 2 a reduced  adrenodoxin[c] '''+''' 1 (25R)-5β-cholestane-3α,7α,26-triol[c] '''=>''' 1 (25R)-3α,7α-dihydroxy-5β-cholestan-26-al[c] '''+''' 2 an oxidized adrenodoxin[c] '''+''' 2 H2O[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_18459]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-6061]], bile acid biosynthesis, neutral pathway: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6061 PWY-6061]
+
−
** '''3''' reactions found over '''29''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R04805 R04805]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237329 44237329]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CCC=CCC4(C(=O)CCC(CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)}}
−
{{#set: gene associated=Tiso_gene_18459}}
+
{{#set: common name=OPC4-trans-2-enoyl-CoA}}
−
{{#set: in pathway=PWY-6061}}
+
{{#set: inchi key=InChIKey=QSAQFDYWYNLXEC-RBHATRMTSA-J}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: molecular weight=981.797    }}
−
{{#set: reconstruction source=orthology-esiliculosus}}
+
{{#set: consumed by=RXN-10705}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: produced by=RXN-10707}}

Revision as of 16:06, 21 March 2018

Metabolite CPD-11526

  • smiles:
    • CCC=CCC4(C(=O)CCC(CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
  • common name:
    • OPC4-trans-2-enoyl-CoA
  • inchi key:
    • InChIKey=QSAQFDYWYNLXEC-RBHATRMTSA-J
  • molecular weight:
    • 981.797
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC=CCC4(C(=O)CCC(CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_2190&oldid=38770"