Difference between revisions of "RIBITOL-2-DEHYDROGENASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.8.4.9-RXN 1.8.4.9-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-40 CPDQT-40] == * smiles: ** CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-] * common name: ** 3-(7'-m...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.8.4.9-RXN 1.8.4.9-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-40 CPDQT-40] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/1.8.4.9 EC-1.8.4.9]
+
** 3-(7'-methylthio)heptylmalate
 +
* inchi key:
 +
** InChIKey=SXLJFGXGVBWOOB-UHFFFAOYSA-L
 +
* molecular weight:
 +
** 276.347   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-(7'-methylthio)heptylmalic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXNQT-4178]]
−
** 2 [[GLUTATHIONE]][c] '''+''' 1 [[APS]][c] '''=>''' 1 [[SO3]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[AMP]][c] '''+''' 1 [[OXIDIZED-GLUTATHIONE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 2 glutathione[c] '''+''' 1 adenosine 5'-phosphosulfate[c] '''=>''' 1 sulfite[c] '''+''' 2 H+[c] '''+''' 1 AMP[c] '''+''' 1 glutathione disulfide[c]
+
* [[RXN-18200]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[SULFMETII-PWY]], sulfate reduction II (assimilatory): [http://metacyc.org/META/NEW-IMAGE?object=SULFMETII-PWY SULFMETII-PWY]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[manual]]
+
−
** Source: [[manual-primary_network]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14141 14141]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237172 44237172]
−
* LIGAND-RXN:
+
{{#set: smiles=CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R05717 R05717]
+
{{#set: common name=3-(7'-methylthio)heptylmalate}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: inchi key=InChIKey=SXLJFGXGVBWOOB-UHFFFAOYSA-L}}
−
{{#set: ec number=EC-1.8.4.9}}
+
{{#set: molecular weight=276.347    }}
−
{{#set: in pathway=SULFMETII-PWY}}
+
{{#set: common name=3-(7'-methylthio)heptylmalic acid}}
−
{{#set: reconstruction category=manual}}
+
{{#set: consumed by=RXNQT-4178}}
−
{{#set: reconstruction source=manual-primary_network}}
+
{{#set: reversible reaction associated=RXN-18200}}

Revision as of 16:07, 21 March 2018

Metabolite CPDQT-40

  • smiles:
    • CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-]
  • common name:
    • 3-(7'-methylthio)heptylmalate
  • inchi key:
    • InChIKey=SXLJFGXGVBWOOB-UHFFFAOYSA-L
  • molecular weight:
    • 276.347
  • Synonym(s):
    • 3-(7'-methylthio)heptylmalic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CSCCCCCCCC(C(O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RIBITOL-2-DEHYDROGENASE-RXN&oldid=38877"