Difference between revisions of "Tiso gene 4112"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_6635 == * left end position: ** 5636 * transcription direction: ** POSITIVE * right end position: ** 8209 * centisome position: ** 47.07651...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-464 CPD-464] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(O...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_6635 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-464 CPD-464] ==
−
* left end position:
+
* smiles:
−
** 5636
+
** CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** prephytoene diphosphate
−
* right end position:
+
* inchi key:
−
** 8209
+
** InChIKey=RVCNKTPCHZNAAO-IMSLGMFESA-K
−
* centisome position:
+
* molecular weight:
−
** 47.07651    
+
** 719.897    
 
* Synonym(s):
 
* Synonym(s):
 +
** (1R,2R,3R)-prephytoene diphosphate
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[UDPNACETYLMURAMATEDEHYDROG-RXN]]
+
* [[RXNARA-8002]]
−
** in-silico_annotation
+
* [[RXN-12245]]
−
***ec-number
+
== Reaction(s) known to produce the compound ==
−
== Pathways associated ==
+
* [[2.5.1.32-RXN]]
−
* [[PWY-6386]]
+
== Reaction(s) of unknown directionality ==
−
* [[PWY-6387]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=5636}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245670 25245670]
−
{{#set: right end position=8209}}
+
* HMDB : HMDB03023
−
{{#set: centisome position=47.07651   }}
+
* CHEBI:
−
{{#set: reaction associated=UDPNACETYLMURAMATEDEHYDROG-RXN}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58011 58011]
−
{{#set: pathway associated=PWY-6386|PWY-6387}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C03427 C03427]
 +
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C}}
 +
{{#set: common name=prephytoene diphosphate}}
 +
{{#set: inchi key=InChIKey=RVCNKTPCHZNAAO-IMSLGMFESA-K}}
 +
{{#set: molecular weight=719.897   }}
 +
{{#set: common name=(1R,2R,3R)-prephytoene diphosphate}}
 +
{{#set: consumed by=RXNARA-8002|RXN-12245}}
 +
{{#set: produced by=2.5.1.32-RXN}}

Revision as of 16:07, 21 March 2018

Metabolite CPD-464

  • smiles:
    • CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C
  • common name:
    • prephytoene diphosphate
  • inchi key:
    • InChIKey=RVCNKTPCHZNAAO-IMSLGMFESA-K
  • molecular weight:
    • 719.897
  • Synonym(s):
    • (1R,2R,3R)-prephytoene diphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=CCCC(=CCCC(=CCCC(=CC1(C(CCC=C(CCC=C(CCC=C(C)C)C)C)(C1COP(OP(=O)([O-])[O-])([O-])=O)C))C)C)C)C" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_4112&oldid=38914"