Difference between revisions of "3-HYDROXY-ISOVALERYL-COA"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.2.1.37-RXN 3.2.1.37-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Beta-xylosidase/alpha...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETO-ADIPYL-COA 3-KETO-ADIPYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC([O-])=...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETO-ADIPYL-COA 3-KETO-ADIPYL-COA] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* common name: | * common name: | ||
− | ** | + | ** 3-oxoadipyl-CoA |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=VKKKAAPGXHWXOO-BIEWRJSYSA-I |
+ | * molecular weight: | ||
+ | ** 904.605 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-ketoadipyl-CoA | ||
+ | ** 3-keto-adipyl-coa | ||
+ | ** β-ketoadipyl-CoA | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN0-2044]] | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | == | + | |
− | * | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266578 45266578] |
− | + | * HMDB : HMDB60378 | |
− | + | * CHEBI: | |
− | * | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57348 57348] |
− | * | + | * LIGAND-CPD: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02232 C02232] |
− | + | {{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | |
− | + | {{#set: common name=3-oxoadipyl-CoA}} | |
− | * | + | {{#set: inchi key=InChIKey=VKKKAAPGXHWXOO-BIEWRJSYSA-I}} |
− | ** [http://www. | + | {{#set: molecular weight=904.605 }} |
− | + | {{#set: common name=3-ketoadipyl-CoA|3-keto-adipyl-coa|β-ketoadipyl-CoA}} | |
− | + | {{#set: reversible reaction associated=RXN0-2044}} | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:08, 21 March 2018
Contents
Metabolite 3-KETO-ADIPYL-COA
- smiles:
- CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- 3-oxoadipyl-CoA
- inchi key:
- InChIKey=VKKKAAPGXHWXOO-BIEWRJSYSA-I
- molecular weight:
- 904.605
- Synonym(s):
- 3-ketoadipyl-CoA
- 3-keto-adipyl-coa
- β-ketoadipyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.