Difference between revisions of "Tiso gene 18366"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_5666 == * left end position: ** 887 * transcription direction: ** NEGATIVE * right end position: ** 4339 * centisome position: ** 6.780827...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2461 CPD0-2461] == * smiles: ** C2(=NC1(=C(NC(N=C(N)1)=O)N2)) * common name: ** isoguanine...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_5666 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2461 CPD0-2461] ==
−
* left end position:
+
* smiles:
−
** 887
+
** C2(=NC1(=C(NC(N=C(N)1)=O)N2))
−
* transcription direction:
+
* common name:
−
** NEGATIVE
+
** isoguanine
−
* right end position:
+
* inchi key:
−
** 4339
+
** InChIKey=DRAVOWXCEBXPTN-UHFFFAOYSA-N
−
* centisome position:
+
* molecular weight:
−
** 6.780827    
+
** 151.127    
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-oxoadenine
 +
** 2-hydroxyadenine
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[RXN-13185]]
+
== Reaction(s) known to produce the compound ==
−
** in-silico_annotation
+
* [[RXN-15139]]
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[RXN-7984]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[RXN-7985]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways associated ==
+
−
* [[PWY-5945]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=887}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=76900 76900]
−
{{#set: right end position=4339}}
+
* CHEMSPIDER:
−
{{#set: centisome position=6.780827   }}
+
** [http://www.chemspider.com/Chemical-Structure.69351.html 69351]
−
{{#set: reaction associated=RXN-13185|RXN-7984|RXN-7985}}
+
* CHEBI:
−
{{#set: pathway associated=PWY-5945}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62462 62462]
 +
* HMDB : HMDB00403
 +
{{#set: smiles=C2(=NC1(=C(NC(N=C(N)1)=O)N2))}}
 +
{{#set: common name=isoguanine}}
 +
{{#set: inchi key=InChIKey=DRAVOWXCEBXPTN-UHFFFAOYSA-N}}
 +
{{#set: molecular weight=151.127   }}
 +
{{#set: common name=2-oxoadenine|2-hydroxyadenine}}
 +
{{#set: produced by=RXN-15139}}

Revision as of 16:08, 21 March 2018

Metabolite CPD0-2461

  • smiles:
    • C2(=NC1(=C(NC(N=C(N)1)=O)N2))
  • common name:
    • isoguanine
  • inchi key:
    • InChIKey=DRAVOWXCEBXPTN-UHFFFAOYSA-N
  • molecular weight:
    • 151.127
  • Synonym(s):
    • 2-oxoadenine
    • 2-hydroxyadenine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_18366&oldid=39085"