Difference between revisions of "PROT-CYS"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_15890 == * left end position: ** 119 * transcription direction: ** POSITIVE * right end position: ** 380 * centisome position: ** 2.517453...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-702 CPD-702] == * smiles: ** C(O)C1(C=CC(=CC=1)[N+]([O-])=O) * common name: ** 4-nitrobenzy...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-702 CPD-702] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(O)C1(C=CC(=CC=1)[N+]([O-])=O) |
| − | * | + | * common name: |
| − | ** | + | ** 4-nitrobenzyl alcohol |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=JKTYGPATCNUWKN-UHFFFAOYSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 153.137 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 4NBA | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[RXN0- | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN0-5141]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 619-73-8 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=69275 69275] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.13585105.html 13585105] |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=41214 41214] | ||
| + | * NCI: | ||
| + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=5389 5389] | ||
| + | {{#set: smiles=C(O)C1(C=CC(=CC=1)[N+]([O-])=O)}} | ||
| + | {{#set: common name=4-nitrobenzyl alcohol}} | ||
| + | {{#set: inchi key=InChIKey=JKTYGPATCNUWKN-UHFFFAOYSA-N}} | ||
| + | {{#set: molecular weight=153.137 }} | ||
| + | {{#set: common name=4NBA}} | ||
| + | {{#set: produced by=RXN0-5141}} | ||
Revision as of 16:08, 21 March 2018
Contents
Metabolite CPD-702
- smiles:
- C(O)C1(C=CC(=CC=1)[N+]([O-])=O)
- common name:
- 4-nitrobenzyl alcohol
- inchi key:
- InChIKey=JKTYGPATCNUWKN-UHFFFAOYSA-N
- molecular weight:
- 153.137
- Synonym(s):
- 4NBA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C1(C=CC(=CC=1)[N+]([O-])=O)" cannot be used as a page name in this wiki.
