|
|
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.21.92-RXN 3.4.21.92-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6746 CPD-6746] == |
− | * direction: | + | * smiles: |
− | ** LEFT-TO-RIGHT | + | ** C1(O)(C(O)C(O)C(OP([O-])([O-])=O)C(O)C(O)1) |
| * common name: | | * common name: |
− | ** ATP-dependent Clp protease proteolytic subunit | + | ** 1D-myo-inositol 2-monophosphate |
− | * ec number: | + | * inchi key: |
− | ** [http://enzyme.expasy.org/EC/3.4.21.92 EC-3.4.21.92] | + | ** InChIKey=INAPMGSXUVUWAF-QWBQGLJISA-L |
| + | * molecular weight: |
| + | ** 258.121 |
| * Synonym(s): | | * Synonym(s): |
| + | ** D-myo-inositol 2-monophosphate |
| + | ** Ins(2)P1 |
| + | ** Ins(2)P |
| + | ** Ins2P |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[RXN-7253]] |
− | ** 1 [[General-Protein-Substrates]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Peptides-holder]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 a protein[c] '''+''' 1 H2O[c] '''=>''' 1 a peptide[c]
| + | |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_10324]] | + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_11705]]
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | * [[Tiso_gene_10005]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | * [[Tiso_gene_999]]
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***AUTOMATED-NAME-MATCH
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | == Pathways == | + | |
− | == Reconstruction information == | + | |
− | * Category: [[orthology]]
| + | |
− | ** Source: [[orthology-esiliculosus]]
| + | |
− | *** Tool: [[pantograph]]
| + | |
− | * Category: [[annotation]]
| + | |
− | ** Source: [[annotation-in-silico_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
− | ** Source: [[annotation-experimental_annotation]]
| + | |
− | *** Tool: [[pathwaytools]]
| + | |
| == External links == | | == External links == |
− | * UNIPROT: | + | * CHEBI: |
− | ** [http://www.uniprot.org/uniprot/P12208 P12208] | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62383 62383] |
− | ** [http://www.uniprot.org/uniprot/Q9JU33 Q9JU33]
| + | {{#set: smiles=C1(O)(C(O)C(O)C(OP([O-])([O-])=O)C(O)C(O)1)}} |
− | ** [http://www.uniprot.org/uniprot/Q9PE41 Q9PE41]
| + | {{#set: common name=1D-myo-inositol 2-monophosphate}} |
− | ** [http://www.uniprot.org/uniprot/P0A6G7 P0A6G7]
| + | {{#set: inchi key=InChIKey=INAPMGSXUVUWAF-QWBQGLJISA-L}} |
− | ** [http://www.uniprot.org/uniprot/P56156 P56156]
| + | {{#set: molecular weight=258.121 }} |
− | ** [http://www.uniprot.org/uniprot/P80244 P80244]
| + | {{#set: common name=D-myo-inositol 2-monophosphate|Ins(2)P1|Ins(2)P|Ins2P}} |
− | ** [http://www.uniprot.org/uniprot/O51556 O51556]
| + | {{#set: consumed by=RXN-7253}} |
− | ** [http://www.uniprot.org/uniprot/O67357 O67357]
| + | |
− | ** [http://www.uniprot.org/uniprot/O83520 O83520]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9HYR9 Q9HYR9]
| + | |
− | ** [http://www.uniprot.org/uniprot/P63783 P63783]
| + | |
− | ** [http://www.uniprot.org/uniprot/O84712 O84712]
| + | |
− | ** [http://www.uniprot.org/uniprot/P43867 P43867]
| + | |
− | ** [http://www.uniprot.org/uniprot/O51698 O51698]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A526 P0A526]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9PLM0 Q9PLM0]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9K709 Q9K709]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WZF9 Q9WZF9]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9RSZ7 Q9RSZ7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9I2U1 Q9I2U1]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9K888 Q9K888]
| + | |
− | ** [http://www.uniprot.org/uniprot/P38002 P38002]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Z759 Q9Z759]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9Z832 Q9Z832]
| + | |
− | ** [http://www.uniprot.org/uniprot/P54413 P54413]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9KQS6 Q9KQS6]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZD29 Q9ZD29]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZL50 Q9ZL50]
| + | |
− | ** [http://www.uniprot.org/uniprot/P12209 P12209]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M2F6 Q7M2F6]
| + | |
− | ** [http://www.uniprot.org/uniprot/P24064 P24064]
| + | |
− | ** [http://www.uniprot.org/uniprot/P36387 P36387]
| + | |
− | ** [http://www.uniprot.org/uniprot/P26567 P26567]
| + | |
− | ** [http://www.uniprot.org/uniprot/P48883 P48883]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q16740 Q16740]
| + | |
− | ** [http://www.uniprot.org/uniprot/P54416 P54416]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59993 Q59993]
| + | |
− | ** [http://www.uniprot.org/uniprot/P74467 P74467]
| + | |
− | ** [http://www.uniprot.org/uniprot/P30063 P30063]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q36863 Q36863]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q42886 Q42886]
| + | |
− | ** [http://www.uniprot.org/uniprot/P56317 P56317]
| + | |
− | ** [http://www.uniprot.org/uniprot/P41609 P41609]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9X7R9 Q9X7R9]
| + | |
− | ** [http://www.uniprot.org/uniprot/O48931 O48931]
| + | |
− | {{#set: direction=LEFT-TO-RIGHT}} | + | |
− | {{#set: common name=ATP-dependent Clp protease proteolytic subunit}} | + | |
− | {{#set: ec number=EC-3.4.21.92}}
| + | |
− | {{#set: gene associated=Tiso_gene_10324|Tiso_gene_11705|Tiso_gene_10005|Tiso_gene_999}} | + | |
− | {{#set: in pathway=}}
| + | |
− | {{#set: reconstruction category=orthology|annotation}} | + | |
− | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}} | + | |
− | {{#set: reconstruction tool=pantograph|pathwaytools}} | + | |