Difference between revisions of "5.99.1.3-RXN"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DEPHOSPHOCOAKIN-RXN DEPHOSPHOCOAKIN-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** dephosp...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-128 CPD1F-128] == * smiles: ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C)CCCC(C)2[CH]3CC4)))) * comm...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-128 CPD1F-128] == |
− | * | + | * smiles: |
− | ** | + | ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C)CCCC(C)2[CH]3CC4)))) |
* common name: | * common name: | ||
− | ** | + | ** ent-kaurene |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=ONVABDHFQKWOSV-HPUSYDDDSA-N |
+ | * molecular weight: | ||
+ | ** 272.473 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** ent-kaur-16-ene | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[1.14.13.78-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * LIPID_MAPS : LMPR0104130002 |
− | ** [http://www.ebi.ac.uk/ | + | * PUBCHEM: |
− | * LIGAND- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11966109 11966109] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.16737395.html 16737395] |
− | {{#set: common name= | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15415 15415] |
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06090 C06090] | |
− | {{#set: | + | {{#set: smiles=C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C)CCCC(C)2[CH]3CC4))))}} |
− | {{#set: | + | {{#set: common name=ent-kaurene}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=ONVABDHFQKWOSV-HPUSYDDDSA-N}} |
+ | {{#set: molecular weight=272.473 }} | ||
+ | {{#set: common name=ent-kaur-16-ene}} | ||
+ | {{#set: consumed by=1.14.13.78-RXN}} |
Revision as of 16:09, 21 March 2018
Contents
Metabolite CPD1F-128
- smiles:
- C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C)CCCC(C)2[CH]3CC4))))
- common name:
- ent-kaurene
- inchi key:
- InChIKey=ONVABDHFQKWOSV-HPUSYDDDSA-N
- molecular weight:
- 272.473
- Synonym(s):
- ent-kaur-16-ene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C)CCCC(C)2[CH]3CC4))))" cannot be used as a page name in this wiki.