Difference between revisions of "3.5.2.17-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11784 RXN-11784] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12902 CPD-12902] == * smiles: ** CC(C)=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(O...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11784 RXN-11784] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12902 CPD-12902] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/1.4.3.21 EC-1.4.3.21]
+
** 5-methylhex-4-enoyl-CoA
 +
* inchi key:
 +
** InChIKey=BEYYLHUMFMWPLH-SVHODSNWSA-J
 +
* molecular weight:
 +
** 873.658   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CADAVERINE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[CPD-12763]][c] '''+''' 1 [[AMMONIUM]][c]
+
* [[RXN-11917]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 oxygen[c] '''+''' 1 cadaverine[c] '''+''' 1 H2O[c] '''=>''' 1 hydrogen peroxide[c] '''+''' 1 5-aminopentanal[c] '''+''' 1 ammonium[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_8756]]
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-athaliana]]
+
−
*** Tool: [[pantograph]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R06740 R06740]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986179 50986179]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIGAND-CPD:
−
{{#set: ec number=EC-1.4.3.21}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C16470 C16470]
−
{{#set: gene associated=Tiso_gene_8756}}
+
{{#set: smiles=CC(C)=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
−
{{#set: in pathway=}}
+
{{#set: common name=5-methylhex-4-enoyl-CoA}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: inchi key=InChIKey=BEYYLHUMFMWPLH-SVHODSNWSA-J}}
−
{{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}}
+
{{#set: molecular weight=873.658    }}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: produced by=RXN-11917}}

Revision as of 16:09, 21 March 2018

Metabolite CPD-12902

  • smiles:
    • CC(C)=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • common name:
    • 5-methylhex-4-enoyl-CoA
  • inchi key:
    • InChIKey=BEYYLHUMFMWPLH-SVHODSNWSA-J
  • molecular weight:
    • 873.658
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=3.5.2.17-RXN&oldid=39193"