Difference between revisions of "Tiso gene 18995"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19157 CPD-19157] == * smiles: ** CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)...")
(Created page with "Category:Gene == Gene Tiso_gene_18995 == * right end position: ** 716 * transcription direction: ** POSITIVE * left end position: ** 367 * centisome position: ** 13.750468...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19157 CPD-19157] ==
+
== Gene Tiso_gene_18995 ==
* smiles:
+
* right end position:
** CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 716
* common name:
+
* transcription direction:
** 3-oxo-(7Z)-tetradecenoyl-CoA
+
** POSITIVE
* inchi key:
+
* left end position:
** InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J
+
** 367
* molecular weight:
+
* centisome position:
** 985.829    
+
** 13.750468    
 
* Synonym(s):
 
* Synonym(s):
** 3-oxo-14:1-Δ7-CoA
 
** 3-oxo-7-cis-tetradecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-17795]]
+
* Reaction: [[RXN-11696]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
* [[RXN-17794]]
+
*** Assignment: ec-number
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: right end position=716}}
{{#set: common name=3-oxo-(7Z)-tetradecenoyl-CoA}}
+
{{#set: transcription direction=POSITIVE}}
{{#set: inchi key=InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J}}
+
{{#set: left end position=367}}
{{#set: molecular weight=985.829   }}
+
{{#set: centisome position=13.750468   }}
{{#set: common name=3-oxo-14:1-Δ7-CoA|3-oxo-7-cis-tetradecenoyl-CoA}}
+
{{#set: reaction associated=RXN-11696}}
{{#set: consumed by=RXN-17795}}
+
{{#set: produced by=RXN-17794}}
+

Latest revision as of 19:05, 21 March 2018

Gene Tiso_gene_18995

  • right end position:
    • 716
  • transcription direction:
    • POSITIVE
  • left end position:
    • 367
  • centisome position:
    • 13.750468
  • Synonym(s):

Reactions associated

Pathways associated

External links