Difference between revisions of "CPD-12016"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6303 PWY-6303] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-31...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12016 CPD-12016] == * smiles: ** CC(=O)NCCC2(=CNC3(=CC=C(OC1(OC(C([O-])=O)C(O)C(O)C(O)1))C=...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12016 CPD-12016] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CC(=O)NCCC2(=CNC3(=CC=C(OC1(OC(C([O-])=O)C(O)C(O)C(O)1))C=C23)) |
* common name: | * common name: | ||
| − | ** | + | ** N-acetyl-serotonin glucuronide |
| + | * inchi key: | ||
| + | ** InChIKey=DRKQFNYKSNWOTC-RNGZQALNSA-M | ||
| + | * molecular weight: | ||
| + | ** 393.372 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** N-acetyl-5-hydroxytryptamine glucuronide |
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-11060]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=29971053 29971053] |
| − | {{#set: | + | {{#set: smiles=CC(=O)NCCC2(=CNC3(=CC=C(OC1(OC(C([O-])=O)C(O)C(O)C(O)1))C=C23))}} |
| − | {{#set: | + | {{#set: common name=N-acetyl-serotonin glucuronide}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=DRKQFNYKSNWOTC-RNGZQALNSA-M}} |
| − | {{#set: | + | {{#set: molecular weight=393.372 }} |
| + | {{#set: common name=N-acetyl-5-hydroxytryptamine glucuronide}} | ||
| + | {{#set: produced by=RXN-11060}} | ||
Latest revision as of 19:06, 21 March 2018
Contents
Metabolite CPD-12016
- smiles:
- CC(=O)NCCC2(=CNC3(=CC=C(OC1(OC(C([O-])=O)C(O)C(O)C(O)1))C=C23))
- common name:
- N-acetyl-serotonin glucuronide
- inchi key:
- InChIKey=DRKQFNYKSNWOTC-RNGZQALNSA-M
- molecular weight:
- 393.372
- Synonym(s):
- N-acetyl-5-hydroxytryptamine glucuronide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(=O)NCCC2(=CNC3(=CC=C(OC1(OC(C([O-])=O)C(O)C(O)C(O)1))C=C23))" cannot be used as a page name in this wiki.
