Difference between revisions of "7-METHYLXANTHINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-590 CPD-590] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)O)O)O)))=CC(O)=C(C=3)O) * common...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-METHYLXANTHINE 7-METHYLXANTHINE] == * smiles: ** CN1(C=NC2(NC(=O)NC(=O)C1=2)) * common name:...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-METHYLXANTHINE 7-METHYLXANTHINE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CN1(C=NC2(NC(=O)NC(=O)C1=2)) |
* common name: | * common name: | ||
| − | ** | + | ** 7-methylxanthine |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=PFWLFWPASULGAN-UHFFFAOYSA-N |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 166.139 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** heteroxanthine |
| + | ** 3,7-dihydro-7-methyl-1H-purine-2,6-dione | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-11521]] |
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=68374 68374] |
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.61660.html 61660] |
| + | * HMDB : HMDB01991 | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=48991 48991] |
| − | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16353 C16353] |
| − | {{#set: smiles= | + | {{#set: smiles=CN1(C=NC2(NC(=O)NC(=O)C1=2))}} |
| − | {{#set: common name= | + | {{#set: common name=7-methylxanthine}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=PFWLFWPASULGAN-UHFFFAOYSA-N}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=166.139 }} |
| − | {{#set: common name= | + | {{#set: common name=heteroxanthine|3,7-dihydro-7-methyl-1H-purine-2,6-dione}} |
| − | + | {{#set: consumed by=RXN-11521}} | |
| − | {{#set: | + | |
Latest revision as of 19:06, 21 March 2018
Contents
Metabolite 7-METHYLXANTHINE
- smiles:
- CN1(C=NC2(NC(=O)NC(=O)C1=2))
- common name:
- 7-methylxanthine
- inchi key:
- InChIKey=PFWLFWPASULGAN-UHFFFAOYSA-N
- molecular weight:
- 166.139
- Synonym(s):
- heteroxanthine
- 3,7-dihydro-7-methyl-1H-purine-2,6-dione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
