Difference between revisions of "PWY-6035"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1065 CPD0-1065] == * smiles: ** C(CC[N+]CCCCC[N+])[N+] * common name: ** aminopropylcadave...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6035 PWY-6035] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1065 CPD0-1065] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6035 PWY-6035] ==
* smiles:
+
* taxonomic range:
** C(CC[N+]CCCCC[N+])[N+]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 
* common name:
 
* common name:
** aminopropylcadaverine
+
** 2,3-cis-flavanols biosynthesis
* inchi key:
+
** InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q
+
* molecular weight:
+
** 162.298   
+
 
* Synonym(s):
 
* Synonym(s):
** N-3-aminopropyl-1,5-diaminopentane
+
** 2,3-cis-flavan-3-ols biosynthesis
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''3''' reactions found over '''3''' reactions in the full pathway
* [[RXN0-5217]]
+
* [[RXN-9723]]
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Tiso_gene_15272]]
 +
*** [[Tiso_gene_9504]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-9724]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_15272]]
 +
*** [[Tiso_gene_9504]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-9725]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_9504]]
 +
*** [[Tiso_gene_15272]]
 +
*** [[Tiso_gene_11016]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33090}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246266 25246266]
+
{{#set: common name=2,3-cis-flavanols biosynthesis}}
* HMDB : HMDB12189
+
{{#set: common name=2,3-cis-flavan-3-ols biosynthesis}}
* CHEBI:
+
{{#set: reaction found=3}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64858 64858]
+
{{#set: total reaction=3}}
* LIGAND-CPD:
+
{{#set: completion rate=100.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C16565 C16565]
+
{{#set: smiles=C(CC[N+]CCCCC[N+])[N+]}}
+
{{#set: common name=aminopropylcadaverine}}
+
{{#set: inchi key=InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q}}
+
{{#set: molecular weight=162.298    }}
+
{{#set: common name=N-3-aminopropyl-1,5-diaminopentane}}
+
{{#set: produced by=RXN0-5217}}
+

Latest revision as of 20:06, 21 March 2018

Pathway PWY-6035

  • taxonomic range:
  • common name:
    • 2,3-cis-flavanols biosynthesis
  • Synonym(s):
    • 2,3-cis-flavan-3-ols biosynthesis

Reaction(s) found

3 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links