Difference between revisions of "LEUCOPELARGONIDIN-CMPD"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-cis-D9-21-3-hydroxyC40-2-ACPs cis-cis-D9-21-3-hydroxyC40-2-ACPs] == * common name: ** a cis...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LEUCOPELARGONIDIN-CMPD LEUCOPELARGONIDIN-CMPD] == * smiles: ** C3(C(C2(OC1(=CC(=CC(=C1C(C2O)O)O...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LEUCOPELARGONIDIN-CMPD LEUCOPELARGONIDIN-CMPD] == |
| + | * smiles: | ||
| + | ** C3(C(C2(OC1(=CC(=CC(=C1C(C2O)O)O)O)))=CC=C(C=3)O) | ||
* common name: | * common name: | ||
| − | ** | + | ** (2R,3S,4S)-leucopelargonidin |
| + | * inchi key: | ||
| + | ** InChIKey=FSVMLWOLZHGCQX-SOUVJXGZSA-N | ||
| + | * molecular weight: | ||
| + | ** 290.272 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** cis-3,4-leucopelargonidin |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[LEUCPEL-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3286789 3286789] |
| − | {{#set: produced by= | + | * CHEMSPIDER: |
| + | ** [http://www.chemspider.com/Chemical-Structure.2535665.html 2535665] | ||
| + | * HMDB : HMDB32322 | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17343 17343] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C03648 C03648] | ||
| + | {{#set: smiles=C3(C(C2(OC1(=CC(=CC(=C1C(C2O)O)O)O)))=CC=C(C=3)O)}} | ||
| + | {{#set: common name=(2R,3S,4S)-leucopelargonidin}} | ||
| + | {{#set: inchi key=InChIKey=FSVMLWOLZHGCQX-SOUVJXGZSA-N}} | ||
| + | {{#set: molecular weight=290.272 }} | ||
| + | {{#set: common name=cis-3,4-leucopelargonidin}} | ||
| + | {{#set: consumed by=LEUCPEL-RXN}} | ||
| + | {{#set: produced by=DIHYDROKAEMPFEROL-4-REDUCTASE-RXN}} | ||
Latest revision as of 19:07, 21 March 2018
Contents
Metabolite LEUCOPELARGONIDIN-CMPD
- smiles:
- C3(C(C2(OC1(=CC(=CC(=C1C(C2O)O)O)O)))=CC=C(C=3)O)
- common name:
- (2R,3S,4S)-leucopelargonidin
- inchi key:
- InChIKey=FSVMLWOLZHGCQX-SOUVJXGZSA-N
- molecular weight:
- 290.272
- Synonym(s):
- cis-3,4-leucopelargonidin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
