Difference between revisions of "PWY-7356"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTEATE L-CYSTEATE] == * smiles: ** C(C([N+])C(=O)[O-])S(=O)(=O)[O-] * common name: ** L-cys...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7356 PWY-7356] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] **...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7356 PWY-7356] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] | ||
* common name: | * common name: | ||
− | ** | + | ** thiamine salvage IV (yeast) |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** thiamin salvage IV (yeast) |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''5''' reactions found over '''7''' reactions in the full pathway | |
− | == Reaction(s) | + | * [[PYRIMSYN3-RXN]] |
− | * [ | + | ** 4 associated gene(s): |
+ | *** [[Tiso_gene_2159]] | ||
+ | *** [[Tiso_gene_16224]] | ||
+ | *** [[Tiso_gene_17192]] | ||
+ | *** [[Tiso_gene_2160]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXNQT-4191]] | ||
+ | ** 5 associated gene(s): | ||
+ | *** [[Tiso_gene_4497]] | ||
+ | *** [[Tiso_gene_15256]] | ||
+ | *** [[Tiso_gene_17625]] | ||
+ | *** [[Tiso_gene_11838]] | ||
+ | *** [[Tiso_gene_17610]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[THI-P-SYN-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Tiso_gene_10320]] | ||
+ | *** [[Tiso_gene_2159]] | ||
+ | *** [[Tiso_gene_2160]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[THIAMIN-PYROPHOSPHOKINASE-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_16512]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[THIAZOLSYN3-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_3173]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=OHMETPYRKIN-RXN OHMETPYRKIN-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=THIAMINASE-RXN THIAMINASE-RXN] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: taxonomic range=TAX-4751}} | |
− | + | {{#set: common name=thiamine salvage IV (yeast)}} | |
− | + | {{#set: common name=thiamin salvage IV (yeast)}} | |
− | + | {{#set: reaction found=5}} | |
− | + | {{#set: total reaction=7}} | |
− | + | {{#set: completion rate=71.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:08, 21 March 2018
Pathway PWY-7356
- taxonomic range:
- common name:
- thiamine salvage IV (yeast)
- Synonym(s):
- thiamin salvage IV (yeast)
Reaction(s) found
5 reactions found over 7 reactions in the full pathway
- PYRIMSYN3-RXN
- 4 associated gene(s):
- 3 reconstruction source(s) associated:
- RXNQT-4191
- 5 associated gene(s):
- 1 reconstruction source(s) associated:
- THI-P-SYN-RXN
- 3 associated gene(s):
- 3 reconstruction source(s) associated:
- THIAMIN-PYROPHOSPHOKINASE-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- THIAZOLSYN3-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated: