Difference between revisions of "Tiso gene 3580"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHYTOL PHYTOL] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CCO * common name: ** phytol * inchi...") |
(Created page with "Category:Gene == Gene Tiso_gene_3580 == * right end position: ** 10383 * transcription direction: ** POSITIVE * left end position: ** 3134 * centisome position: ** 16.5601...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_3580 == |
− | * | + | * right end position: |
− | ** | + | ** 10383 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 3134 |
− | * | + | * centisome position: |
− | ** | + | ** 16.560106 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[ATPASE-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | + | *** Assignment: ec-number | |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: right end position=10383}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=3134}} | |
− | + | {{#set: centisome position=16.560106 }} | |
− | + | {{#set: reaction associated=ATPASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:08, 21 March 2018
Gene Tiso_gene_3580
- right end position:
- 10383
- transcription direction:
- POSITIVE
- left end position:
- 3134
- centisome position:
- 16.560106
- Synonym(s):
Reactions associated
- Reaction: ATPASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation