Difference between revisions of "PWY-3841"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FAD FAD] == * smiles: ** CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3841 PWY-3841] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FAD FAD] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3841 PWY-3841] ==
−
* smiles:
+
* taxonomic range:
−
** CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(C(O)C(O)C(N3(C=NC2(C(N)=NC=NC=23)))O4))=O)([O-])=O)O)5))=C6))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 
* common name:
 
* common name:
−
** FAD
+
** folate transformations II
−
* inchi key:
+
−
** InChIKey=IMGVNJNCCGXBHD-UYBVJOGSSA-K
+
−
* molecular weight:
+
−
** 782.533   
+
 
* Synonym(s):
 
* Synonym(s):
−
** flavin adenine dinucleotide oxidized
 
−
** flavin adenine dinucleotide
 
−
** flavitan
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[MEPROPCOA-FAD-RXN]]
+
'''9''' reactions found over '''11''' reactions in the full pathway
−
* [[ACOA120or]]
+
* [[1.5.1.20-RXN]]
−
* [[MCDH_2mb2coa]]
+
** 2 associated gene(s):
−
* [[ACOA140or]]
+
*** [[Tiso_gene_14582]]
−
* [[ACOA160or]]
+
*** [[Tiso_gene_16954]]
−
* [[ACOA80or]]
+
** 4 reconstruction source(s) associated:
−
* [[MCDH]]
+
*** [[annotation-in-silico_annotation]]
−
* [[IVCDH]]
+
*** [[manual-primary_network]]
−
* [[ACOA40or]]
+
*** [[annotation-experimental_annotation]]
−
== Reaction(s) known to produce the compound ==
+
*** [[orthology-esiliculosus]]
−
* [[G3PD3]]
+
* [[DIHYDROFOLATEREDUCT-RXN]]
−
* [[FADSYN-RXN]]
+
** 0 associated gene:
−
== Reaction(s) of unknown directionality ==
+
** 1 reconstruction source(s) associated:
−
* [[PPCOAOm]]
+
*** [[manual-primary_network]]
−
* [[RXN-14264]]
+
* [[FORMATETHFLIG-RXN]]
−
* [[RXN-14193]]
+
** 2 associated gene(s):
 +
*** [[Tiso_gene_432]]
 +
*** [[Tiso_gene_7582]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[GLYOHMETRANS-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_16153]]
 +
*** [[Tiso_gene_7776]]
 +
*** [[Tiso_gene_18652]]
 +
*** [[Tiso_gene_16154]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[HOMOCYSMETB12-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_1602]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[METHENYLTHFCYCLOHYDRO-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[manual-primary_network]]
 +
* [[METHYLENETHFDEHYDROG-NADP-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_6004]]
 +
*** [[Tiso_gene_432]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-6321]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_17287]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[THYMIDYLATESYN-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_7708]]
 +
*** [[Tiso_gene_18478]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=5-FORMYL-THF-CYCLO-LIGASE-RXN 5-FORMYL-THF-CYCLO-LIGASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=GCVMULTI-RXN GCVMULTI-RXN]
 
== External links  ==
 
== External links  ==
−
* CAS : 146-14-5
+
* ARACYC:
−
* Wikipedia : Flavin_adenine_dinucleotide
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-3841 PWY-3841]
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33090}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46906035 46906035]
+
{{#set: common name=folate transformations II}}
−
* HMDB : HMDB01248
+
{{#set: reaction found=9}}
−
* LIGAND-CPD:
+
{{#set: total reaction=11}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00016 C00016]
+
{{#set: completion rate=82.0}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.13082029.html 13082029]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57692 57692]
+
−
* BIGG : fad
+
−
{{#set: smiles=CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(C(O)C(O)C(N3(C=NC2(C(N)=NC=NC=23)))O4))=O)([O-])=O)O)5))=C6))}}
+
−
{{#set: common name=FAD}}
+
−
{{#set: inchi key=InChIKey=IMGVNJNCCGXBHD-UYBVJOGSSA-K}}
+
−
{{#set: molecular weight=782.533    }}
+
−
{{#set: common name=flavin adenine dinucleotide oxidized|flavin adenine dinucleotide|flavitan}}
+
−
{{#set: consumed by=MEPROPCOA-FAD-RXN|ACOA120or|MCDH_2mb2coa|ACOA140or|ACOA160or|ACOA80or|MCDH|IVCDH|ACOA40or}}
+
−
{{#set: produced by=G3PD3|FADSYN-RXN}}
+
−
{{#set: reversible reaction associated=PPCOAOm|RXN-14264|RXN-14193}}
+

Latest revision as of 19:12, 21 March 2018

Pathway PWY-3841

  • taxonomic range:
  • common name:
    • folate transformations II
  • Synonym(s):

Reaction(s) found

9 reactions found over 11 reactions in the full pathway

Reaction(s) not found

External links



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-3841&oldid=40112"