Difference between revisions of "Tiso gene 3732"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12159 CPD-12159] == * smiles: ** CC(CCC=C1(CC1))[CH]4(CC[CH]5(C3(CC[CH]2(CC(O)CCC(C)2C=3CCC...")
(Created page with "Category:Gene == Gene Tiso_gene_3732 == * right end position: ** 3733 * transcription direction: ** POSITIVE * left end position: ** 525 * centisome position: ** 2.1731932...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12159 CPD-12159] ==
+
== Gene Tiso_gene_3732 ==
−
* smiles:
+
* right end position:
−
** CC(CCC=C1(CC1))[CH]4(CC[CH]5(C3(CC[CH]2(CC(O)CCC(C)2C=3CCC(C)45))))
+
** 3733
−
* common name:
+
* transcription direction:
−
** 26,27-dehydrozymosterol
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=PARCYOHVCUKSCA-BJDKXSRUSA-N
+
** 525
−
* molecular weight:
+
* centisome position:
−
** 382.628    
+
** 2.1731932    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-11201]]
+
* Reaction: [[ACETYLHOMOSER-CYS-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-creinhardtii]]
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[ACHMSSELCYSL]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[ACHMSSELCYSLh]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[CYSTATHIONINE-BETA-SYNTHASE-RXN]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[CYSTHIOCYS-RXN]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[HOMOSERDEAM-RXN]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[LCYSDESULF-RXN]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[METBALT-RXN]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[O-SUCCHOMOSERLYASE-RXN]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[RXN-12728]]
 +
** Source: [[orthology-creinhardtii]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[RXN-12729]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-creinhardtii]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[RXN-14048]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-14049]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-15128]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-15129]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-15130]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-15131]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-15137]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-9384]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[SUCHMSSELCYSL]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[SUCHMSSELCYSLh]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[SULFOCYS-RXN]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways associated ==
 +
* [[PWY-5344]]
 +
* [[PWY-6936]]
 +
* [[PWY-I9]]
 +
* [[LCYSDEG-PWY]]
 +
* [[HOMOSER-METSYN-PWY]]
 +
* [[PWY-702]]
 +
* [[HOMOCYSDEGR-PWY]]
 +
* [[PWY-801]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=3733}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820155 91820155]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CC(CCC=C1(CC1))[CH]4(CC[CH]5(C3(CC[CH]2(CC(O)CCC(C)2C=3CCC(C)45))))}}
+
{{#set: left end position=525}}
−
{{#set: common name=26,27-dehydrozymosterol}}
+
{{#set: centisome position=2.1731932   }}
−
{{#set: inchi key=InChIKey=PARCYOHVCUKSCA-BJDKXSRUSA-N}}
+
{{#set: reaction associated=ACETYLHOMOSER-CYS-RXN|ACHMSSELCYSL|ACHMSSELCYSLh|CYSTATHIONINE-BETA-SYNTHASE-RXN|CYSTHIOCYS-RXN|HOMOSERDEAM-RXN|LCYSDESULF-RXN|METBALT-RXN|O-SUCCHOMOSERLYASE-RXN|RXN-12728|RXN-12729|RXN-14048|RXN-14049|RXN-15128|RXN-15129|RXN-15130|RXN-15131|RXN-15137|RXN-9384|SUCHMSSELCYSL|SUCHMSSELCYSLh|SULFOCYS-RXN}}
−
{{#set: molecular weight=382.628   }}
+
{{#set: pathway associated=PWY-5344|PWY-6936|PWY-I9|LCYSDEG-PWY|HOMOSER-METSYN-PWY|PWY-702|HOMOCYSDEGR-PWY|PWY-801}}
−
{{#set: consumed by=RXN-11201}}
+

Latest revision as of 19:12, 21 March 2018

Gene Tiso_gene_3732

  • right end position:
    • 3733
  • transcription direction:
    • POSITIVE
  • left end position:
    • 525
  • centisome position:
    • 2.1731932
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_3732&oldid=40135"