Difference between revisions of "SsRNAs"

Latest revision as of 19:15, 21 March 2018

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19163 CPD-19163] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ssRNAs ssRNAs] ==
-* smiles:
-** CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 * common name:
-** (2E,11Z)-octadecenoyl-CoA
+** a single-stranded RNA
-* inchi key:
-** InChIKey=OPMPWWFMNYWBGF-PKYBCSRXSA-J
-* molecular weight:
-** 1025.937
 * Synonym(s):
-** 18:2-&Delta;2,&Delta;11-CoA
+** a ssRNA
-** 2-trans,11-cis-octadecenoyl-CoA
 == Reaction(s) known to consume the compound ==
 == Reaction(s) known to produce the compound ==
-* [[RXN-17784]]
 == Reaction(s) of unknown directionality ==
+* [[2.7.7.8-RXN]]
 == External links  ==
-{{#set: smiles=CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+{{#set: common name=a single-stranded RNA}}
-{{#set: common name=(2E,11Z)-octadecenoyl-CoA}}
+{{#set: common name=a ssRNA}}
-{{#set: inchi key=InChIKey=OPMPWWFMNYWBGF-PKYBCSRXSA-J}}
+{{#set: reversible reaction associated=2.7.7.8-RXN}}
-{{#set: molecular weight=1025.937    }}
-{{#set: common name=18:2-&Delta;2,&Delta;11-CoA|2-trans,11-cis-octadecenoyl-CoA}}
-{{#set: produced by=RXN-17784}}