Difference between revisions of "CPD-11495"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_15379 == * right end position: ** 2311 * transcription direction: ** NEGATIVE * left end position: ** 348 * centisome position: ** 6.884273...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11495 CPD-11495] == * smiles: ** C(=O)([O-])CC1(=CC=CC=C(O)1) * common name: ** 2-hydroxyph...")
 
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_15379 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11495 CPD-11495] ==
−
* right end position:
+
* smiles:
−
** 2311
+
** C(=O)([O-])CC1(=CC=CC=C(O)1)
−
* transcription direction:
+
* common name:
−
** NEGATIVE
+
** 2-hydroxyphenylacetate
−
* left end position:
+
* inchi key:
−
** 348
+
** InChIKey=CCVYRRGZDBSHFU-UHFFFAOYSA-M
−
* centisome position:
+
* molecular weight:
−
** 6.884273    
+
** 151.141    
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-hydroxyphenylacetic acid
 +
** benzeneacetic acid, 2-hydroxy-
 +
** 2-hydroxybenzeneacetic acid
 +
** acetic acid, (o-hydroxyphenyl)-
 +
** o-hydroxy phenylacetic acid
 +
** o-hydroxyphenylacetate
 +
** o-hydroxyphenylacetic acid
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* Reaction: [[DIHYDROOROT-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Source: [[annotation-in-silico_annotation]]
+
* [[RXN-10815]]
−
*** Assignment: ec-number
+
== Reaction(s) of unknown directionality ==
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Assignment: ec-number
+
−
** Source: [[orthology-synechocystis]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
== Pathways associated ==
+
−
* [[PWY-7790]]
+
−
* [[PWY-7791]]
+
−
* [[PWY-5686]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: right end position=2311}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6933325 6933325]
−
{{#set: left end position=348}}
+
* CHEMSPIDER:
−
{{#set: centisome position=6.884273   }}
+
** [http://www.chemspider.com/Chemical-Structure.5307390.html 5307390]
−
{{#set: reaction associated=DIHYDROOROT-RXN}}
+
* HMDB : HMDB00669
−
{{#set: pathway associated=PWY-7790|PWY-7791|PWY-5686}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62423 62423]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C05852 C05852]
 +
{{#set: smiles=C(=O)([O-])CC1(=CC=CC=C(O)1)}}
 +
{{#set: common name=2-hydroxyphenylacetate}}
 +
{{#set: inchi key=InChIKey=CCVYRRGZDBSHFU-UHFFFAOYSA-M}}
 +
{{#set: molecular weight=151.141   }}
 +
{{#set: common name=2-hydroxyphenylacetic acid|benzeneacetic acid, 2-hydroxy-|2-hydroxybenzeneacetic acid|acetic acid, (o-hydroxyphenyl)-|o-hydroxy phenylacetic acid|o-hydroxyphenylacetate|o-hydroxyphenylacetic acid}}
 +
{{#set: produced by=RXN-10815}}

Latest revision as of 19:16, 21 March 2018

Metabolite CPD-11495

  • smiles:
    • C(=O)([O-])CC1(=CC=CC=C(O)1)
  • common name:
    • 2-hydroxyphenylacetate
  • inchi key:
    • InChIKey=CCVYRRGZDBSHFU-UHFFFAOYSA-M
  • molecular weight:
    • 151.141
  • Synonym(s):
    • 2-hydroxyphenylacetic acid
    • benzeneacetic acid, 2-hydroxy-
    • 2-hydroxybenzeneacetic acid
    • acetic acid, (o-hydroxyphenyl)-
    • o-hydroxy phenylacetic acid
    • o-hydroxyphenylacetate
    • o-hydroxyphenylacetic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])CC1(=CC=CC=C(O)1)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-11495&oldid=40563"