Difference between revisions of "PWY-6953"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14115 CPD-14115] == * smiles: ** C3(C(C1(CC2(=CC=C(C=C(OC1)2)O)))=CC=C(C=3)O) * common name...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6953 PWY-6953] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6953 PWY-6953] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
* common name: | * common name: | ||
| − | ** | + | ** dTDP-3-acetamido-α-D-fucose biosynthesis |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** dTDP-3-acetamido-3,6-dideoxy-α-D-galactose biosynthesis |
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''2''' reactions found over '''5''' reactions in the full pathway | |
| − | == Reaction(s) | + | * [[DTDPGLUCDEHYDRAT-RXN]] |
| − | * [[RXN- | + | ** 2 associated gene(s): |
| + | *** [[Tiso_gene_7329]] | ||
| + | *** [[Tiso_gene_12394]] | ||
| + | ** 4 reconstruction source(s) associated: | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[annotation-in-silico_annotation]] | ||
| + | *** [[orthology-synechocystis]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | * [[DTDPGLUCOSEPP-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[Tiso_gene_14704]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-synechocystis]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12806 RXN-12806] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12811 RXN-12811] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12839 RXN-12839] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=dTDP-3-acetamido-α-D-fucose biosynthesis}} | |
| − | + | {{#set: common name=dTDP-3-acetamido-3,6-dideoxy-α-D-galactose biosynthesis}} | |
| − | + | {{#set: reaction found=2}} | |
| − | + | {{#set: total reaction=5}} | |
| − | + | {{#set: completion rate=40.0}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:19, 21 March 2018
Pathway PWY-6953
- taxonomic range:
- common name:
- dTDP-3-acetamido-α-D-fucose biosynthesis
- Synonym(s):
- dTDP-3-acetamido-3,6-dideoxy-α-D-galactose biosynthesis
Reaction(s) found
2 reactions found over 5 reactions in the full pathway
- DTDPGLUCDEHYDRAT-RXN
- 2 associated gene(s):
- 4 reconstruction source(s) associated:
- DTDPGLUCOSEPP-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
