Difference between revisions of "Holo-Transcarboxylases"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19489 CPD-19489] == * smiles: ** CSCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * common name: ** 3-isop...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=holo-Transcarboxylases holo-Transcarboxylases] == * common name: ** a holo-[methylmalonyl-CoA:p...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=holo-Transcarboxylases holo-Transcarboxylases] == |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a holo-[methylmalonyl-CoA:pyruvate carboxytransferase] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** holo-[methylmalonyl-CoA:pyruvate carboxytransferase] | ||
| + | ** biotin-[methylmalonyl-CoA:pyruvate carboxytransferase] | ||
| + | ** holo-[methylmalonyl-CoA-carboxyltransferase] | ||
| + | ** biotin-[methylmalonyl-CoA-carboxyltransferase] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[6.3.4.9-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | {{#set: | + | {{#set: common name=a holo-[methylmalonyl-CoA:pyruvate carboxytransferase]}} |
| − | {{#set: common name= | + | {{#set: common name=holo-[methylmalonyl-CoA:pyruvate carboxytransferase]|biotin-[methylmalonyl-CoA:pyruvate carboxytransferase]|holo-[methylmalonyl-CoA-carboxyltransferase]|biotin-[methylmalonyl-CoA-carboxyltransferase]}} |
| − | + | {{#set: produced by=6.3.4.9-RXN}} | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Latest revision as of 20:19, 21 March 2018
Contents
Metabolite holo-Transcarboxylases
- common name:
- a holo-[methylmalonyl-CoA:pyruvate carboxytransferase]
- Synonym(s):
- holo-[methylmalonyl-CoA:pyruvate carboxytransferase]
- biotin-[methylmalonyl-CoA:pyruvate carboxytransferase]
- holo-[methylmalonyl-CoA-carboxyltransferase]
- biotin-[methylmalonyl-CoA-carboxyltransferase]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a holo-[methylmalonyl-CoA:pyruvate carboxytransferase" cannot be used as a page name in this wiki.
- "holo-[methylmalonyl-CoA:pyruvate carboxytransferase" cannot be used as a page name in this wiki.
- "biotin-[methylmalonyl-CoA:pyruvate carboxytransferase" cannot be used as a page name in this wiki.
- "holo-[methylmalonyl-CoA-carboxyltransferase" cannot be used as a page name in this wiki.
- "biotin-[methylmalonyl-CoA-carboxyltransferase" cannot be used as a page name in this wiki.
