Difference between revisions of "PWY-7159"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15977 CPD-15977] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)OC(CCCCCCCC=CCCCCCCCC)=O * c...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7159 PWY-7159] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-241806 TAX-...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15977 CPD-15977] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7159 PWY-7159] ==
* smiles:
+
* taxonomic range:
** CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)OC(CCCCCCCC=CCCCCCCCC)=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-241806 TAX-241806]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3041 TAX-3041]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3312 TAX-3312]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3208 TAX-3208]
 
* common name:
 
* common name:
** 1,2-dioleoylglycerol
+
** 3,8-divinyl-chlorophyllide a biosynthesis III (aerobic, light independent)
* inchi key:
+
** InChIKey=AFSHUZFNMVJNKX-LLWMBOQKSA-N
+
* molecular weight:
+
** 620.995   
+
 
* Synonym(s):
 
* Synonym(s):
** dioleoyl-sn-glycerol
+
** light-independent aerobic 3,8-divinyl-chlorophyllide a biosynthesis
** diolein
+
** 1,2-dioleoyl-DL-glycerol
+
** 9-octadecenoic acid, 1-(hydroxymethyl)-1,2-ethanediyl ester, (9Z,9'Z)-
+
** glycerol dioleate
+
** 1,2-diolein
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''8''' reactions found over '''9''' reactions in the full pathway
* [[RXN-15090]]
+
* [[PROTOPORGENOXI-RXN]]
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Tiso_gene_11986]]
 +
*** [[Tiso_gene_15401]]
 +
** 6 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
* [[RXN-5282]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[manual-primary_network]]
 +
* [[RXN-5283]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[manual-primary_network]]
 +
* [[RXN-5284]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[manual-primary_network]]
 +
* [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_19451]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN0-1461]]
 +
** 5 associated gene(s):
 +
*** [[Tiso_gene_3671]]
 +
*** [[Tiso_gene_2247]]
 +
*** [[Tiso_gene_13364]]
 +
*** [[Tiso_gene_13365]]
 +
*** [[Tiso_gene_2246]]
 +
** 7 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
* [[RXN1F-20]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_11960]]
 +
*** [[Tiso_gene_5993]]
 +
*** [[Tiso_gene_9870]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-esiliculosus]]
 +
* [[UROGENDECARBOX-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_18743]]
 +
*** [[Tiso_gene_19684]]
 +
*** [[Tiso_gene_18744]]
 +
*** [[Tiso_gene_5173]]
 +
** 6 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-synechocystis]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-creinhardtii]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17485 RXN-17485]
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMGL02010049
+
* PLANTCYC : PWY-7159
* PUBCHEM:
+
{{#set: taxonomic range=TAX-241806}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9543716 9543716]
+
{{#set: taxonomic range=TAX-2}}
* CHEMSPIDER:
+
{{#set: taxonomic range=TAX-1117}}
** [http://www.chemspider.com/Chemical-Structure.4593734.html 4593734]
+
{{#set: taxonomic range=TAX-3041}}
* CHEBI:
+
{{#set: taxonomic range=TAX-3312}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=52333 52333]
+
{{#set: taxonomic range=TAX-3208}}
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)OC(CCCCCCCC=CCCCCCCCC)=O}}
+
{{#set: common name=3,8-divinyl-chlorophyllide a biosynthesis III (aerobic, light independent)}}
{{#set: common name=1,2-dioleoylglycerol}}
+
{{#set: common name=light-independent aerobic 3,8-divinyl-chlorophyllide a biosynthesis}}
{{#set: inchi key=InChIKey=AFSHUZFNMVJNKX-LLWMBOQKSA-N}}
+
{{#set: reaction found=8}}
{{#set: molecular weight=620.995    }}
+
{{#set: total reaction=9}}
{{#set: common name=dioleoyl-sn-glycerol|diolein|1,2-dioleoyl-DL-glycerol|9-octadecenoic acid, 1-(hydroxymethyl)-1,2-ethanediyl ester, (9Z,9'Z)-|glycerol dioleate|1,2-diolein}}
+
{{#set: completion rate=89.0}}
{{#set: produced by=RXN-15090}}
+

Latest revision as of 19:19, 21 March 2018

Pathway PWY-7159

  • taxonomic range:
  • common name:
    • 3,8-divinyl-chlorophyllide a biosynthesis III (aerobic, light independent)
  • Synonym(s):
    • light-independent aerobic 3,8-divinyl-chlorophyllide a biosynthesis

Reaction(s) found

8 reactions found over 9 reactions in the full pathway

Reaction(s) not found

External links

  • PLANTCYC : PWY-7159