Difference between revisions of "PWY-7159"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15977 CPD-15977] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)OC(CCCCCCCC=CCCCCCCCC)=O * c...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7159 PWY-7159] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-241806 TAX-...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7159 PWY-7159] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-241806 TAX-241806] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3041 TAX-3041] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3312 TAX-3312] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3208 TAX-3208] | ||
* common name: | * common name: | ||
− | ** | + | ** 3,8-divinyl-chlorophyllide a biosynthesis III (aerobic, light independent) |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** light-independent aerobic 3,8-divinyl-chlorophyllide a biosynthesis |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''8''' reactions found over '''9''' reactions in the full pathway | |
− | * [[RXN- | + | * [[PROTOPORGENOXI-RXN]] |
− | == Reaction(s) | + | ** 2 associated gene(s): |
+ | *** [[Tiso_gene_11986]] | ||
+ | *** [[Tiso_gene_15401]] | ||
+ | ** 6 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[manual-primary_network]] | ||
+ | * [[RXN-5282]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[manual-primary_network]] | ||
+ | * [[RXN-5283]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[manual-primary_network]] | ||
+ | * [[RXN-5284]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[manual-primary_network]] | ||
+ | * [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_19451]] | ||
+ | ** 5 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN0-1461]] | ||
+ | ** 5 associated gene(s): | ||
+ | *** [[Tiso_gene_3671]] | ||
+ | *** [[Tiso_gene_2247]] | ||
+ | *** [[Tiso_gene_13364]] | ||
+ | *** [[Tiso_gene_13365]] | ||
+ | *** [[Tiso_gene_2246]] | ||
+ | ** 7 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | * [[RXN1F-20]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Tiso_gene_11960]] | ||
+ | *** [[Tiso_gene_5993]] | ||
+ | *** [[Tiso_gene_9870]] | ||
+ | ** 5 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[UROGENDECARBOX-RXN]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[Tiso_gene_18743]] | ||
+ | *** [[Tiso_gene_19684]] | ||
+ | *** [[Tiso_gene_18744]] | ||
+ | *** [[Tiso_gene_5173]] | ||
+ | ** 6 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17485 RXN-17485] | ||
== External links == | == External links == | ||
− | * | + | * PLANTCYC : PWY-7159 |
− | + | {{#set: taxonomic range=TAX-241806}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: taxonomic range=TAX-1117}} | |
− | + | {{#set: taxonomic range=TAX-3041}} | |
− | + | {{#set: taxonomic range=TAX-3312}} | |
− | + | {{#set: taxonomic range=TAX-3208}} | |
− | {{#set: | + | {{#set: common name=3,8-divinyl-chlorophyllide a biosynthesis III (aerobic, light independent)}} |
− | {{#set: | + | {{#set: common name=light-independent aerobic 3,8-divinyl-chlorophyllide a biosynthesis}} |
− | {{#set: | + | {{#set: reaction found=8}} |
− | {{#set: | + | {{#set: total reaction=9}} |
− | {{#set: common name= | + | {{#set: completion rate=89.0}} |
− | {{#set: | + |
Latest revision as of 19:19, 21 March 2018
Pathway PWY-7159
- taxonomic range:
- common name:
- 3,8-divinyl-chlorophyllide a biosynthesis III (aerobic, light independent)
- Synonym(s):
- light-independent aerobic 3,8-divinyl-chlorophyllide a biosynthesis
Reaction(s) found
8 reactions found over 9 reactions in the full pathway
- PROTOPORGENOXI-RXN
- 2 associated gene(s):
- 6 reconstruction source(s) associated:
- RXN-5282
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-5283
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-5284
- 0 associated gene:
- 1 reconstruction source(s) associated:
- RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN
- 1 associated gene(s):
- 5 reconstruction source(s) associated:
- RXN0-1461
- 5 associated gene(s):
- 7 reconstruction source(s) associated:
- RXN1F-20
- 3 associated gene(s):
- 5 reconstruction source(s) associated:
- UROGENDECARBOX-RXN
- 4 associated gene(s):
- 6 reconstruction source(s) associated:
Reaction(s) not found
External links
- PLANTCYC : PWY-7159