Difference between revisions of "Tiso gene 2034"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE-5DP-3DP GUANOSINE-5DP-3DP] == * smiles: ** C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP...")
(Created page with "Category:Gene == Gene Tiso_gene_2034 == * right end position: ** 13886 * transcription direction: ** NEGATIVE * left end position: ** 9085 * centisome position: ** 43.7052...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE-5DP-3DP GUANOSINE-5DP-3DP] ==
+
== Gene Tiso_gene_2034 ==
−
* smiles:
+
* right end position:
−
** C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP([O-])([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
+
** 13886
−
* common name:
+
* transcription direction:
−
** ppGpp
+
** NEGATIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=BUFLLCUFNHESEH-UUOKFMHZSA-I
+
** 9085
−
* molecular weight:
+
* centisome position:
−
** 598.123    
+
** 43.7052    
 
* Synonym(s):
 
* Synonym(s):
−
** guanosine tetraphosphate
 
−
** guanosine 5'-diphosphate,3'-diphosphate
 
−
** guanosine 3',5'-bispyrophosphate
 
−
** guanosine 3',5'-bis(diphosphate)
 
−
** guanosine 3'-diphosphate 5'-diphosphate
 
−
** magic spot
 
−
** guanosine-5',3'-tetraphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[PPGPPSYN-RXN]]
+
* Reaction: [[3.1.3.16-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[GDPPYPHOSKIN-RXN]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
−
* [[GBDP]]
+
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB04022
+
{{#set: right end position=13886}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15938967 15938967]
+
{{#set: left end position=9085}}
−
* HMDB : HMDB59638
+
{{#set: centisome position=43.7052   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=3.1.3.16-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01228 C01228]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.13082026.html 13082026]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77828 77828]
+
−
* BIGG : ppgpp
+
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP([O-])([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}}
+
−
{{#set: common name=ppGpp}}
+
−
{{#set: inchi key=InChIKey=BUFLLCUFNHESEH-UUOKFMHZSA-I}}
+
−
{{#set: molecular weight=598.123   }}
+
−
{{#set: common name=guanosine tetraphosphate|guanosine 5'-diphosphate,3'-diphosphate|guanosine 3',5'-bispyrophosphate|guanosine 3',5'-bis(diphosphate)|guanosine 3'-diphosphate 5'-diphosphate|magic spot|guanosine-5',3'-tetraphosphate}}
+
−
{{#set: consumed by=PPGPPSYN-RXN}}
+
−
{{#set: produced by=GDPPYPHOSKIN-RXN}}
+
−
{{#set: reversible reaction associated=GBDP}}
+

Latest revision as of 19:20, 21 March 2018

Gene Tiso_gene_2034

  • right end position:
    • 13886
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 9085
  • centisome position:
    • 43.7052
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_2034&oldid=40995"