Difference between revisions of "CPD-17348"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12935 CPD-12935] == * smiles: ** CC(C=CC=C(C)C=CC=C(C)C=O)=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17348 CPD-17348] == * smiles: ** CCCCCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17348 CPD-17348] == |
* smiles: | * smiles: | ||
| − | ** CC( | + | ** CCCCCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* common name: | * common name: | ||
| − | ** | + | ** (2E, 11Z,14Z)-icosa-2,11,14-trienoyl-CoA |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=JLHULLPFTGLIGF-DBYUABGNSA-J |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 1051.975 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-16097]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-16096]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193765 72193765] |
| − | {{#set: smiles=CC( | + | * CHEBI: |
| − | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76409 76409] |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=CCCCCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: molecular weight= | + | {{#set: common name=(2E, 11Z,14Z)-icosa-2,11,14-trienoyl-CoA}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=JLHULLPFTGLIGF-DBYUABGNSA-J}} |
| − | {{#set: produced by=RXN- | + | {{#set: molecular weight=1051.975 }} |
| + | {{#set: consumed by=RXN-16097}} | ||
| + | {{#set: produced by=RXN-16096}} | ||
Latest revision as of 19:20, 21 March 2018
Contents
Metabolite CPD-17348
- smiles:
- CCCCCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- (2E, 11Z,14Z)-icosa-2,11,14-trienoyl-CoA
- inchi key:
- InChIKey=JLHULLPFTGLIGF-DBYUABGNSA-J
- molecular weight:
- 1051.975
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC=CCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
