Difference between revisions of "PWY4FS-7"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHOLESTEROL CHOLESTEROL] == * smiles: ** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-7 PWY4FS-7] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHOLESTEROL CHOLESTEROL] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-7 PWY4FS-7] ==
* smiles:
+
* taxonomic range:
** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
** cholesterol
+
** phosphatidylglycerol biosynthesis I (plastidic)
* inchi key:
+
** InChIKey=HVYWMOMLDIMFJA-DPAQBDIFSA-N
+
* molecular weight:
+
** 386.66   
+
 
* Synonym(s):
 
* Synonym(s):
** 5-cholestene-3β-ol
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-12693]]
+
'''3''' reactions found over '''4''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[PGPPHOSPHA-RXN]]
* [[RXN66-323]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_18092]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[PHOSPHAGLYPSYN-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[PWY0-1319]]
 +
** 0 associated gene:
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* CAS : 57-88-5
+
{{#set: taxonomic range=TAX-2759}}
* DRUGBANK : DB04540
+
{{#set: taxonomic range=TAX-2}}
* PUBCHEM:
+
{{#set: common name=phosphatidylglycerol biosynthesis I (plastidic)}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5997 5997]
+
{{#set: reaction found=3}}
* HMDB : HMDB00067
+
{{#set: total reaction=4}}
* LIGAND-CPD:
+
{{#set: completion rate=75.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C00187 C00187]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.5775.html 5775]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16113 16113]
+
* METABOLIGHTS : MTBLC16113
+
{{#set: smiles=CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: common name=cholesterol}}
+
{{#set: inchi key=InChIKey=HVYWMOMLDIMFJA-DPAQBDIFSA-N}}
+
{{#set: molecular weight=386.66    }}
+
{{#set: common name=5-cholestene-3β-ol}}
+
{{#set: consumed by=RXN-12693}}
+
{{#set: produced by=RXN66-323}}
+

Latest revision as of 19:21, 21 March 2018

Pathway PWY4FS-7

  • taxonomic range:
  • common name:
    • phosphatidylglycerol biosynthesis I (plastidic)
  • Synonym(s):

Reaction(s) found

3 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links