Difference between revisions of "CPD-7417"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_575 == * Synonym(s): == Reactions associated == * Reaction: ADENOSINETRIPHOSPHATASE-RXN ** Source: orthology-esiliculosus == Pathw...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7417 CPD-7417] == * smiles: ** C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O * common n...")
 
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_575 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7417 CPD-7417] ==
 +
* smiles:
 +
** C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O
 +
* common name:
 +
** cis-coumarinic acid-β-D-glucoside
 +
* inchi key:
 +
** InChIKey=GVRIYIMNJGULCZ-QLFWQTQQSA-M
 +
* molecular weight:
 +
** 325.294   
 
* Synonym(s):
 
* Synonym(s):
 +
** coumarinic acid glucoside
 +
** coumarinate glucoside
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* Reaction: [[ADENOSINETRIPHOSPHATASE-RXN]]
+
* [[RXN-8036]]
** Source: [[orthology-esiliculosus]]
+
== Reaction(s) known to produce the compound ==
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=ADENOSINETRIPHOSPHATASE-RXN}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C05839 C05839]
 +
* HMDB : HMDB60077
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62223 62223]
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25796113 25796113]
 +
{{#set: smiles=C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O}}
 +
{{#set: common name=cis-coumarinic acid-β-D-glucoside}}
 +
{{#set: inchi key=InChIKey=GVRIYIMNJGULCZ-QLFWQTQQSA-M}}
 +
{{#set: molecular weight=325.294    }}
 +
{{#set: common name=coumarinic acid glucoside|coumarinate glucoside}}
 +
{{#set: consumed by=RXN-8036}}

Latest revision as of 20:21, 21 March 2018

Metabolite CPD-7417

  • smiles:
    • C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O
  • common name:
    • cis-coumarinic acid-β-D-glucoside
  • inchi key:
    • InChIKey=GVRIYIMNJGULCZ-QLFWQTQQSA-M
  • molecular weight:
    • 325.294
  • Synonym(s):
    • coumarinic acid glucoside
    • coumarinate glucoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O" cannot be used as a page name in this wiki.