Difference between revisions of "RXN-11481"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRO-DIOH-BENZOATE DIHYDRO-DIOH-BENZOATE] == * smiles: ** C([O-])(=O)C1(=CC=CC(C1O)O) * comm...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11481 RXN-11481] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-hydroxyacyl-[acyl-carrier...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11481 RXN-11481] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
| − | ** | + | ** 3-hydroxyacyl-[acyl-carrier-protein] dehydratase |
| − | + | * ec number: | |
| − | + | ** [http://enzyme.expasy.org/EC/4.2.1.59 EC-4.2.1.59] | |
| − | * | + | |
| − | ** | + | |
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[3-hydroxypimeloyl-ACP-methyl-esters]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[Enoylpimeloyl-ACP-methyl-esters]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 a (3R)-3-hydroxypimeloyl-[acp] methyl ester[c] '''=>''' 1 H2O[c] '''+''' 1 an enoylpimeloyl-[acp] methyl ester[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_6885]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | * Gene: [[Tiso_gene_6884]] | ||
| + | ** Source: [[annotation-experimental_annotation]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | == Pathways == | ||
| + | * [[PWY-6519]], 8-amino-7-oxononanoate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6519 PWY-6519] | ||
| + | ** '''9''' reactions found over '''11''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | *** Tool: [[pantograph]] | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-experimental_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=3-hydroxyacyl-[acyl-carrier-protein] dehydratase}} | |
| − | + | {{#set: ec number=EC-4.2.1.59}} | |
| − | + | {{#set: gene associated=Tiso_gene_6885|Tiso_gene_6884}} | |
| − | + | {{#set: in pathway=PWY-6519}} | |
| − | + | {{#set: reconstruction category=orthology|annotation}} | |
| − | + | {{#set: reconstruction source=orthology-creinhardtii|annotation-experimental_annotation}} | |
| − | + | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:21, 21 March 2018
Contents
Reaction RXN-11481
- direction:
- LEFT-TO-RIGHT
- common name:
- 3-hydroxyacyl-[acyl-carrier-protein] dehydratase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 3-hydroxypimeloyl-ACP-methyl-esters[c] => 1 WATER[c] + 1 Enoylpimeloyl-ACP-methyl-esters[c]
- With common name(s):
- 1 a (3R)-3-hydroxypimeloyl-[acp] methyl ester[c] => 1 H2O[c] + 1 an enoylpimeloyl-[acp] methyl ester[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_6885
- Source: orthology-creinhardtii
- Gene: Tiso_gene_6884
- Source: annotation-experimental_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-experimental_annotation
Pathways
- PWY-6519, 8-amino-7-oxononanoate biosynthesis I: PWY-6519
- 9 reactions found over 11 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
External links
"3-hydroxyacyl-[acyl-carrier-protein] dehydratase" cannot be used as a page name in this wiki.
