Difference between revisions of "N-ACETYL-D-MANNOSAMINE-6P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_17311 == * right end position: ** 3641 * transcription direction: ** NEGATIVE * left end position: ** 435 * centisome position: ** 11.46547...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-MANNOSAMINE-6P N-ACETYL-D-MANNOSAMINE-6P] == * smiles: ** CC(=O)NC1(C(O)OC(COP([O-])...")
 
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_17311 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-MANNOSAMINE-6P N-ACETYL-D-MANNOSAMINE-6P] ==
* right end position:
+
* smiles:
** 3641
+
** CC(=O)NC1(C(O)OC(COP([O-])(=O)[O-])C(O)C(O)1)
* transcription direction:
+
* common name:
** NEGATIVE
+
** N-acetyl-D-mannosamine 6-phosphate
* left end position:
+
* inchi key:
** 435
+
** InChIKey=BRGMHAYQAZFZDJ-ZTVVOAFPSA-L
* centisome position:
+
* molecular weight:
** 11.465472    
+
** 299.174    
 
* Synonym(s):
 
* Synonym(s):
 +
** ManNAc-6-P
 +
** N-acetylmannosamine-6-P
 +
** N-acetyl-mannosamine-6-P
 +
** N-acetyl-D-mannosamine-6-P
 +
** N-acetyl-mannosamine 6-phosphate
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* Reaction: [[DXS-RXN]]
+
* [[RXN-9988]]
** Source: [[annotation-in-silico_annotation]]
+
== Reaction(s) known to produce the compound ==
*** Assignment: ec-number
+
== Reaction(s) of unknown directionality ==
** Source: [[annotation-experimental_annotation]]
+
*** Assignment: ec-number
+
** Source: [[orthology-athaliana]]
+
** Source: [[orthology-synechocystis]]
+
** Source: [[orthology-esiliculosus]]
+
** Source: [[orthology-creinhardtii]]
+
== Pathways associated ==
+
* [[NONMEVIPP-PWY]]
+
* [[PWY-6891]]
+
* [[PYRIDOXSYN-PWY]]
+
* [[PWY-6892]]
+
* [[PWY-7560]]
+
 
== External links  ==
 
== External links  ==
{{#set: right end position=3641}}
+
* LIGAND-CPD:
{{#set: transcription direction=NEGATIVE}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C04257 C04257]
{{#set: left end position=435}}
+
* HMDB : HMDB01121
{{#set: centisome position=11.465472   }}
+
* CHEBI:
{{#set: reaction associated=DXS-RXN}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28273 28273]
{{#set: pathway associated=NONMEVIPP-PWY|PWY-6891|PYRIDOXSYN-PWY|PWY-6892|PWY-7560}}
+
* BIGG : acmanap
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54758653 54758653]
 +
{{#set: smiles=CC(=O)NC1(C(O)OC(COP([O-])(=O)[O-])C(O)C(O)1)}}
 +
{{#set: common name=N-acetyl-D-mannosamine 6-phosphate}}
 +
{{#set: inchi key=InChIKey=BRGMHAYQAZFZDJ-ZTVVOAFPSA-L}}
 +
{{#set: molecular weight=299.174   }}
 +
{{#set: common name=ManNAc-6-P|N-acetylmannosamine-6-P|N-acetyl-mannosamine-6-P|N-acetyl-D-mannosamine-6-P|N-acetyl-mannosamine 6-phosphate}}
 +
{{#set: consumed by=RXN-9988}}

Latest revision as of 19:24, 21 March 2018

Metabolite N-ACETYL-D-MANNOSAMINE-6P

  • smiles:
    • CC(=O)NC1(C(O)OC(COP([O-])(=O)[O-])C(O)C(O)1)
  • common name:
    • N-acetyl-D-mannosamine 6-phosphate
  • inchi key:
    • InChIKey=BRGMHAYQAZFZDJ-ZTVVOAFPSA-L
  • molecular weight:
    • 299.174
  • Synonym(s):
    • ManNAc-6-P
    • N-acetylmannosamine-6-P
    • N-acetyl-mannosamine-6-P
    • N-acetyl-D-mannosamine-6-P
    • N-acetyl-mannosamine 6-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=O)NC1(C(O)OC(COP([O-])(=O)[O-])C(O)C(O)1)" cannot be used as a page name in this wiki.