Difference between revisions of "PWY-7797"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OROTIDINE-5-PHOSPHATE OROTIDINE-5-PHOSPHATE] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7797 PWY-7797] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OROTIDINE-5-PHOSPHATE OROTIDINE-5-PHOSPHATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7797 PWY-7797] ==
* smiles:
+
* taxonomic range:
** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C(C(=O)[O-])=CC(=O)NC(=O)2))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
** orotidine 5'-phosphate
+
** nocardicin A biosynthesis
* inchi key:
+
** InChIKey=KYOBSHFOBAOFBF-XVFCMESISA-K
+
* molecular weight:
+
** 365.17   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[orPDC]]
+
'''1''' reactions found over '''6''' reactions in the full pathway
* [[OROTPDECARB-RXN]]
+
* [[RXN-17832]]
== Reaction(s) known to produce the compound ==
+
** 4 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_4147]]
* [[OROPRIBTRANS-RXN]]
+
*** [[Tiso_gene_13074]]
* [[orPRT]]
+
*** [[Tiso_gene_12875]]
 +
*** [[Tiso_gene_19324]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17831 RXN-17831]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17833 RXN-17833]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17837 RXN-17837]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17838 RXN-17838]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17843 RXN-17843]
 
== External links  ==
 
== External links  ==
* CAS : 2149-82-8
+
{{#set: taxonomic range=TAX-2}}
* BIGG : orot5p
+
{{#set: common name=nocardicin A biosynthesis}}
* PUBCHEM:
+
{{#set: reaction found=1}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878393 46878393]
+
{{#set: total reaction=6}}
* HMDB : HMDB00218
+
{{#set: completion rate=17.0}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C01103 C01103]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57538 57538]
+
* METABOLIGHTS : MTBLC57538
+
{{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C(C(=O)[O-])=CC(=O)NC(=O)2))}}
+
{{#set: common name=orotidine 5'-phosphate}}
+
{{#set: inchi key=InChIKey=KYOBSHFOBAOFBF-XVFCMESISA-K}}
+
{{#set: molecular weight=365.17    }}
+
{{#set: consumed by=orPDC|OROTPDECARB-RXN}}
+
{{#set: reversible reaction associated=OROPRIBTRANS-RXN|orPRT}}
+

Latest revision as of 20:26, 21 March 2018

Pathway PWY-7797

  • taxonomic range:
  • common name:
    • nocardicin A biosynthesis
  • Synonym(s):

Reaction(s) found

1 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links