Difference between revisions of "AMINOACYLASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CREATINE CREATINE] == * smiles: ** C(C(=O)[O-])N(C)C(N)=[N+] * common name: ** creatine * inchi...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AMINOACYLASE-RXN AMINOACYLASE-RXN] == * direction: ** REVERSIBLE * common name: ** acy1-like_metall...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AMINOACYLASE-RXN AMINOACYLASE-RXN] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
* common name: | * common name: | ||
| − | ** | + | ** acy1-like_metalloprotease |
| − | + | * ec number: | |
| − | + | ** [http://enzyme.expasy.org/EC/3.5.1.14 EC-3.5.1.14] | |
| − | * | + | |
| − | ** | + | |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[WATER]][c] '''+''' 1 [[N-Acylated-Aliphatic-Amino-Acids]][c] '''<=>''' 1 [[Aliphatic-L-Amino-Acids]][c] '''+''' 1 [[Carboxylates]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 H2O[c] '''+''' 1 an N-acylated aliphatic-L-amino acid[c] '''<=>''' 1 an aliphatic L-amino acid[c] '''+''' 1 a carboxylate[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_16879]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | * | + | * RHEA: |
| − | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15565 15565] | |
| − | ** [http:// | + | * LIGAND-RXN: |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?R01263 R01263] | |
| − | * LIGAND- | + | * UNIPROT: |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/Q03154 Q03154] |
| − | * | + | ** [http://www.uniprot.org/uniprot/Q8X8Q0 Q8X8Q0] |
| − | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P72349 P72349] |
| − | * | + | ** [http://www.uniprot.org/uniprot/P37111 P37111] |
| − | ** [http://www. | + | {{#set: direction=REVERSIBLE}} |
| − | * | + | {{#set: common name=acy1-like_metalloprotease}} |
| − | {{#set: | + | {{#set: ec number=EC-3.5.1.14}} |
| − | {{#set: common name= | + | {{#set: gene associated=Tiso_gene_16879}} |
| − | {{#set: | + | {{#set: in pathway=}} |
| − | {{#set: | + | {{#set: reconstruction category=annotation}} |
| − | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation}} |
| − | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 19:28, 21 March 2018
Contents
Reaction AMINOACYLASE-RXN
- direction:
- REVERSIBLE
- common name:
- acy1-like_metalloprotease
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 N-Acylated-Aliphatic-Amino-Acids[c] <=> 1 Aliphatic-L-Amino-Acids[c] + 1 Carboxylates[c]
- With common name(s):
- 1 H2O[c] + 1 an N-acylated aliphatic-L-amino acid[c] <=> 1 an aliphatic L-amino acid[c] + 1 a carboxylate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_16879
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
