Difference between revisions of "CPDQT-36"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Deoxyhypusine-Synthase-Lysine Deoxyhypusine-Synthase-Lysine] == * common name: ** a [deoxyhypus...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-36 CPDQT-36] == * smiles: ** C(C(CCCSC)C(O)C(=O)[O-])(=O)[O-] * common name: ** 3-(3'-met...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-36 CPDQT-36] == |
+ | * smiles: | ||
+ | ** C(C(CCCSC)C(O)C(=O)[O-])(=O)[O-] | ||
* common name: | * common name: | ||
− | ** | + | ** 3-(3'-methylthio)propylmalate |
+ | * inchi key: | ||
+ | ** InChIKey=SQXVIIOPMYSNCP-UHFFFAOYSA-L | ||
+ | * molecular weight: | ||
+ | ** 220.24 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-(3'-methylthio)propylmalic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXNQT-4165]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-18208]] | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: consumed by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237292 44237292] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=133501 133501] | ||
+ | {{#set: smiles=C(C(CCCSC)C(O)C(=O)[O-])(=O)[O-]}} | ||
+ | {{#set: common name=3-(3'-methylthio)propylmalate}} | ||
+ | {{#set: inchi key=InChIKey=SQXVIIOPMYSNCP-UHFFFAOYSA-L}} | ||
+ | {{#set: molecular weight=220.24 }} | ||
+ | {{#set: common name=3-(3'-methylthio)propylmalic acid}} | ||
+ | {{#set: consumed by=RXNQT-4165}} | ||
+ | {{#set: reversible reaction associated=RXN-18208}} |
Latest revision as of 19:28, 21 March 2018
Contents
Metabolite CPDQT-36
- smiles:
- C(C(CCCSC)C(O)C(=O)[O-])(=O)[O-]
- common name:
- 3-(3'-methylthio)propylmalate
- inchi key:
- InChIKey=SQXVIIOPMYSNCP-UHFFFAOYSA-L
- molecular weight:
- 220.24
- Synonym(s):
- 3-(3'-methylthio)propylmalic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(CCCSC)C(O)C(=O)[O-])(=O)[O-" cannot be used as a page name in this wiki.