Difference between revisions of "PWY-3641"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7414 CPD-7414] == * smiles: ** CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3641 PWY-3641] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-12...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7414 CPD-7414] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3641 PWY-3641] ==
* smiles:
+
* taxonomic range:
** CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC2(C(C)=CCCC(C)(C)2)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
 
* common name:
 
* common name:
** ε-carotene
+
** L-carnitine degradation III
* inchi key:
+
** InChIKey=QABFXOMOOYWZLZ-GDBZIMIPSA-N
+
* molecular weight:
+
** 536.882   
+
 
* Synonym(s):
 
* Synonym(s):
** ε,ε-carotene
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''3''' reactions in the full pathway
* [[RXN-8028]]
+
* [[1.1.1.39-RXN]]
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
 +
*** [[Tiso_gene_12896]]
 +
*** [[Tiso_gene_6675]]
 +
*** [[Tiso_gene_12200]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-6002]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_7322]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-5921 RXN-5921]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-1224}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12358808 12358808]
+
{{#set: common name=L-carnitine degradation III}}
* LIGAND-CPD:
+
{{#set: reaction found=2}}
** [http://www.genome.jp/dbget-bin/www_bget?C16276 C16276]
+
{{#set: total reaction=3}}
{{#set: smiles=CC(=CC=CC=C(C)C=CC=C(C)C=CC1(C(C)(C)CCC=C(C)1))C=CC=C(C)C=CC2(C(C)=CCCC(C)(C)2)}}
+
{{#set: completion rate=67.0}}
{{#set: common name=ε-carotene}}
+
{{#set: inchi key=InChIKey=QABFXOMOOYWZLZ-GDBZIMIPSA-N}}
+
{{#set: molecular weight=536.882    }}
+
{{#set: common name=ε,ε-carotene}}
+
{{#set: produced by=RXN-8028}}
+

Latest revision as of 19:31, 21 March 2018

Pathway PWY-3641

  • taxonomic range:
  • common name:
    • L-carnitine degradation III
  • Synonym(s):

Reaction(s) found

2 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links