Difference between revisions of "PWY-7294"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19169 CPD-19169] == * smiles: ** CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7294 PWY-7294] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19169 CPD-19169] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7294 PWY-7294] ==
* smiles:
+
* taxonomic range:
** CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
 
* common name:
 
* common name:
** 3-oxo-(9Z)-octadecenoyl-CoA
+
** xylose degradation IV
* inchi key:
+
** InChIKey=AVEYYKDEKGJVBU-BPMMELMSSA-J
+
* molecular weight:
+
** 1041.936   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-oxo-18:1-Δ9-CoA
 
** 3-oxo-9-cis-octadecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-17778]]
+
'''2''' reactions found over '''7''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[GLYCOLATE-REDUCTASE-RXN]]
* [[RXN-17777]]
+
** 2 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_91]]
 +
*** [[Tiso_gene_777]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
* [[MALSYN-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_14377]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=4.1.2.28-RXN 4.1.2.28-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12246 RXN-12246]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14641 RXN-14641]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14642 RXN-14642]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=XYLONATE-DEHYDRATASE-RXN XYLONATE-DEHYDRATASE-RXN]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: taxonomic range=TAX-2157}}
{{#set: common name=3-oxo-(9Z)-octadecenoyl-CoA}}
+
{{#set: common name=xylose degradation IV}}
{{#set: inchi key=InChIKey=AVEYYKDEKGJVBU-BPMMELMSSA-J}}
+
{{#set: reaction found=2}}
{{#set: molecular weight=1041.936    }}
+
{{#set: total reaction=7}}
{{#set: common name=3-oxo-18:1-Δ9-CoA|3-oxo-9-cis-octadecenoyl-CoA}}
+
{{#set: completion rate=29.0}}
{{#set: consumed by=RXN-17778}}
+
{{#set: produced by=RXN-17777}}
+

Latest revision as of 19:32, 21 March 2018

Pathway PWY-7294

  • taxonomic range:
  • common name:
    • xylose degradation IV
  • Synonym(s):

Reaction(s) found

2 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links