Difference between revisions of "CPD-712"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5466 RXN-5466] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-712 CPD-712] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-712 CPD-712] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34)))) |
− | * | + | * common name: |
− | ** | + | ** 6-deoxocathasterone |
+ | * inchi key: | ||
+ | ** InChIKey=ZHZKWZJLUNXOSN-YUZBOUAZSA-N | ||
+ | * molecular weight: | ||
+ | ** 418.702 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** deoxocathasterone | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-774]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-773]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | = | + | |
− | + | ||
− | * | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * LIPID_MAPS : LMST01030124 |
− | ** [http://www.ebi.ac.uk/ | + | * PUBCHEM: |
− | * LIGAND- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16061344 16061344] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20714 20714] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15798 C15798] |
− | {{#set: | + | {{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} |
− | {{#set: | + | {{#set: common name=6-deoxocathasterone}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=ZHZKWZJLUNXOSN-YUZBOUAZSA-N}} |
− | {{#set: | + | {{#set: molecular weight=418.702 }} |
+ | {{#set: common name=deoxocathasterone}} | ||
+ | {{#set: consumed by=RXN-774}} | ||
+ | {{#set: produced by=RXN-773}} |
Latest revision as of 19:32, 21 March 2018
Contents
Metabolite CPD-712
- smiles:
- CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- common name:
- 6-deoxocathasterone
- inchi key:
- InChIKey=ZHZKWZJLUNXOSN-YUZBOUAZSA-N
- molecular weight:
- 418.702
- Synonym(s):
- deoxocathasterone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.