Difference between revisions of "CPD-8619"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-37 RXN1G-37] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-delta2-cis-delta7-C26:2...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8619 CPD-8619] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-]...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-37 RXN1G-37] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8619 CPD-8619] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C
 
* common name:
 
* common name:
−
** trans-delta2-cis-delta7-C26:2-[acyl-carrier protein] reductase
+
** 4α-carboxy-5α-cholesta-8-en-3β-ol
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.3.1.M4 EC-1.3.1.M4]
+
** InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M
 +
* molecular weight:
 +
** 429.662   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN66-23]]
−
** 1 [[PROTON]][c] '''+''' 1 [[trans-D2-cis-D7-cerotoyl-ACPs]][c] '''+''' 1 [[NADH]][c] '''=>''' 1 [[cis-delta7-cerotoyl-ACPs]][c] '''+''' 1 [[NAD]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H+[c] '''+''' 1 a trans-delta2-cis-delta7-C26:2-[acp][c] '''+''' 1 NADH[c] '''=>''' 1 a cis-delta7-C26:1-[acp][c] '''+''' 1 NAD+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_10778]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
+
−
** '''86''' reactions found over '''182''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=trans-delta2-cis-delta7-C26:2-[acyl-carrier protein] reductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91826593 91826593]
−
{{#set: ec number=EC-1.3.1.M4}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_10778}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87055 87055]
−
{{#set: in pathway=PWYG-321}}
+
* HMDB : HMDB12166
−
{{#set: reconstruction category=orthology}}
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C}}
−
{{#set: reconstruction source=orthology-esiliculosus}}
+
{{#set: common name=4α-carboxy-5α-cholesta-8-en-3β-ol}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: inchi key=InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M}}
 +
{{#set: molecular weight=429.662    }}
 +
{{#set: consumed by=RXN66-23}}

Latest revision as of 19:33, 21 March 2018

Metabolite CPD-8619

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C
  • common name:
    • 4α-carboxy-5α-cholesta-8-en-3β-ol
  • inchi key:
    • InChIKey=RODBXVVNKJCWQR-GSQAGGHASA-M
  • molecular weight:
    • 429.662
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C([O-])=O)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-8619&oldid=42309"