Difference between revisions of "Tiso gene 18566"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14706 CPD-14706] == * smiles: ** CCCCCC(O)C(CC=O)SCC([N+])C(=O)[O-] * common name: ** 4-hyd...")
(Created page with "Category:Gene == Gene Tiso_gene_18566 == * right end position: ** 2300 * transcription direction: ** POSITIVE * left end position: ** 24 * centisome position: ** 0.8163265...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14706 CPD-14706] ==
+
== Gene Tiso_gene_18566 ==
−
* smiles:
+
* right end position:
−
** CCCCCC(O)C(CC=O)SCC([N+])C(=O)[O-]
+
** 2300
−
* common name:
+
* transcription direction:
−
** 4-hydroxy-2-nonenal-[L-Cys] conjugate
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=SALPDUSHMTYYOH-UHFFFAOYSA-N
+
** 24
−
* molecular weight:
+
* centisome position:
−
** 277.378    
+
** 0.8163265    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[ACOA120or]]
−
* [[RXN-13677]]
+
** Source: [[orthology-creinhardtii]]
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[ACOA140or]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[ACOA160or]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[ACOA40or]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[ACOA80or]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[ACYL-COA-OXIDASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[LONG-CHAIN-ACYL-COA-DEHYDROGENASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-10696]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-10706]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-10707]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-11026]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-11734]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12518]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-12669]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-13451]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-13615]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14131]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14193]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-14229]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-14262]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-14278]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-14576]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-14771]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-14775]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-14785]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-14789]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-14796]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-16134]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16540]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-16557]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-17113]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-6920]]
 +
* [[PWY-7340]]
 +
* [[PWY-7656]]
 +
* [[PWY-7291]]
 +
* [[PWY-735]]
 +
* [[PWY-7606]]
 +
* [[PWY-7338]]
 +
* [[PWY-7094]]
 +
* [[PWY-6837]]
 +
* [[PWY66-391]]
 +
* [[PWY-5136]]
 +
* [[PWY-7726]]
 +
* [[PWY-7007]]
 +
* [[PWY-7337]]
 +
* [[PWY-7288]]
 +
* [[PWY-7654]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=2300}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657989 90657989]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CCCCCC(O)C(CC=O)SCC([N+])C(=O)[O-]}}
+
{{#set: left end position=24}}
−
{{#set: common name=4-hydroxy-2-nonenal-[L-Cys] conjugate}}
+
{{#set: centisome position=0.8163265   }}
−
{{#set: inchi key=InChIKey=SALPDUSHMTYYOH-UHFFFAOYSA-N}}
+
{{#set: reaction associated=ACOA120or|ACOA140or|ACOA160or|ACOA40or|ACOA80or|ACYL-COA-OXIDASE-RXN|LONG-CHAIN-ACYL-COA-DEHYDROGENASE-RXN|RXN-10696|RXN-10706|RXN-10707|RXN-11026|RXN-11734|RXN-12518|RXN-12669|RXN-13451|RXN-13615|RXN-14131|RXN-14193|RXN-14229|RXN-14262|RXN-14278|RXN-14576|RXN-14771|RXN-14775|RXN-14785|RXN-14789|RXN-14796|RXN-16134|RXN-16540|RXN-16557|RXN-17113}}
−
{{#set: molecular weight=277.378   }}
+
{{#set: pathway associated=PWY-6920|PWY-7340|PWY-7656|PWY-7291|PWY-735|PWY-7606|PWY-7338|PWY-7094|PWY-6837|PWY66-391|PWY-5136|PWY-7726|PWY-7007|PWY-7337|PWY-7288|PWY-7654}}
−
{{#set: produced by=RXN-13677}}
+

Latest revision as of 20:33, 21 March 2018

Gene Tiso_gene_18566

  • right end position:
    • 2300
  • transcription direction:
    • POSITIVE
  • left end position:
    • 24
  • centisome position:
    • 0.8163265
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_18566&oldid=42365"