Difference between revisions of "DGMP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-2-Haloacids S-2-Haloacids] == * common name: ** an (S)-2-haloacid * Synonym(s): == Reaction(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGMP DGMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) * commo...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGMP DGMP] == |
+ | * smiles: | ||
+ | ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) | ||
* common name: | * common name: | ||
− | ** | + | ** dGMP |
+ | * inchi key: | ||
+ | ** InChIKey=LTFMZDNNPPEQNG-KVQBGUIXSA-L | ||
+ | * molecular weight: | ||
+ | ** 345.208 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2'-dG-5'-MP | ||
+ | ** 2'-deoxyguanosine 5'-monophosphate | ||
+ | ** guanine riboside | ||
+ | ** vernine | ||
+ | ** 2'-deoxyguanosine 5'-phosphate | ||
+ | ** deoxyguanosine-phosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[GMKALT-RXN]] |
+ | * [[ATDGM]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN0-385]] | ||
+ | * [[DGSNPT]] | ||
+ | * [[RXN-14208]] | ||
+ | * [[RXN-14218]] | ||
+ | * [[DGTD]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[DMPH]] |
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 902-04-5 |
− | {{#set: consumed by= | + | * BIGG : dgmp |
− | {{#set: reversible reaction associated= | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6994968 6994968] | ||
+ | * HMDB : HMDB01044 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00362 C00362] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.5362940.html 5362940] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57673 57673] | ||
+ | * METABOLIGHTS : MTBLC57673 | ||
+ | {{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}} | ||
+ | {{#set: common name=dGMP}} | ||
+ | {{#set: inchi key=InChIKey=LTFMZDNNPPEQNG-KVQBGUIXSA-L}} | ||
+ | {{#set: molecular weight=345.208 }} | ||
+ | {{#set: common name=2'-dG-5'-MP|2'-deoxyguanosine 5'-monophosphate|guanine riboside|vernine|2'-deoxyguanosine 5'-phosphate|deoxyguanosine-phosphate}} | ||
+ | {{#set: consumed by=GMKALT-RXN|ATDGM}} | ||
+ | {{#set: produced by=RXN0-385|DGSNPT|RXN-14208|RXN-14218|DGTD}} | ||
+ | {{#set: reversible reaction associated=DMPH}} |
Latest revision as of 19:34, 21 March 2018
Contents
Metabolite DGMP
- smiles:
- C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
- common name:
- dGMP
- inchi key:
- InChIKey=LTFMZDNNPPEQNG-KVQBGUIXSA-L
- molecular weight:
- 345.208
- Synonym(s):
- 2'-dG-5'-MP
- 2'-deoxyguanosine 5'-monophosphate
- guanine riboside
- vernine
- 2'-deoxyguanosine 5'-phosphate
- deoxyguanosine-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 902-04-5
- BIGG : dgmp
- PUBCHEM:
- HMDB : HMDB01044
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC57673
"C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.