Difference between revisions of "Tiso gene 2246"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13534 CPD-13534] == * smiles: ** CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OC...")
(Created page with "Category:Gene == Gene Tiso_gene_2246 == * right end position: ** 19716 * transcription direction: ** POSITIVE * left end position: ** 15552 * centisome position: ** 77.659...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13534 CPD-13534] ==
+
== Gene Tiso_gene_2246 ==
* smiles:
+
* right end position:
** CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 19716
* common name:
+
* transcription direction:
** β-ketovaleryl-CoA
+
** POSITIVE
* inchi key:
+
* left end position:
** InChIKey=WIOQNWTZBOQTEU-ZMHDXICWSA-J
+
** 15552
* molecular weight:
+
* centisome position:
** 861.604    
+
** 77.65904    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN0-1461]]
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
* [[RXN-12560]]
+
*** Assignment: ec-number
* [[RXN-12561]]
+
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY0-1415]]
 +
* [[HEME-BIOSYNTHESIS-II]]
 +
* [[CHLOROPHYLL-SYN]]
 +
* [[PWY-7159]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=19716}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658928 90658928]
+
{{#set: transcription direction=POSITIVE}}
{{#set: smiles=CCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: left end position=15552}}
{{#set: common name=β-ketovaleryl-CoA}}
+
{{#set: centisome position=77.65904   }}
{{#set: inchi key=InChIKey=WIOQNWTZBOQTEU-ZMHDXICWSA-J}}
+
{{#set: reaction associated=RXN0-1461}}
{{#set: molecular weight=861.604   }}
+
{{#set: pathway associated=PWY0-1415|HEME-BIOSYNTHESIS-II|CHLOROPHYLL-SYN|PWY-7159}}
{{#set: reversible reaction associated=RXN-12560|RXN-12561}}
+

Latest revision as of 19:35, 21 March 2018

Gene Tiso_gene_2246

  • right end position:
    • 19716
  • transcription direction:
    • POSITIVE
  • left end position:
    • 15552
  • centisome position:
    • 77.65904
  • Synonym(s):

Reactions associated

Pathways associated

External links