Difference between revisions of "Tiso gene 12389"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLYSINE ALLYSINE] == * smiles: ** [CH](=O)CCCC([N+])C(=O)[O-] * common name: ** (S)-2-amino-6-...") |
(Created page with "Category:Gene == Gene Tiso_gene_12389 == * right end position: ** 6968 * transcription direction: ** NEGATIVE * left end position: ** 3269 * centisome position: ** 46.2114...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_12389 == |
− | * | + | * right end position: |
− | ** | + | ** 6968 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 3269 |
− | * | + | * centisome position: |
− | ** | + | ** 46.21148 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[1 | + | * Reaction: [[1-PHOSPHATIDYLINOSITOL-KINASE-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: ec-number |
− | == | + | == Pathways associated == |
− | * [[ | + | * [[PWY-6352]] |
− | * [[ | + | * [[PWY-6351]] |
== External links == | == External links == | ||
− | + | {{#set: right end position=6968}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=3269}} | |
− | + | {{#set: centisome position=46.21148 }} | |
− | + | {{#set: reaction associated=1-PHOSPHATIDYLINOSITOL-KINASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-6352|PWY-6351}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + |
Latest revision as of 19:36, 21 March 2018
Gene Tiso_gene_12389
- right end position:
- 6968
- transcription direction:
- NEGATIVE
- left end position:
- 3269
- centisome position:
- 46.21148
- Synonym(s):
Reactions associated
- Reaction: 1-PHOSPHATIDYLINOSITOL-KINASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation