Difference between revisions of "D-GLT"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Monocarboxylic-Acid-Amides Monocarboxylic-Acid-Amides] == * common name: ** a monocarboxylic ac...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLT D-GLT] == * smiles: ** C(CCC(C(=O)[O-])[N+])([O-])=O * common name: ** D-glutamate * inch...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLT D-GLT] == |
+ | * smiles: | ||
+ | ** C(CCC(C(=O)[O-])[N+])([O-])=O | ||
* common name: | * common name: | ||
− | ** | + | ** D-glutamate |
+ | * inchi key: | ||
+ | ** InChIKey=WHUUTDBJXJRKMK-GSVOUGTGSA-M | ||
+ | * molecular weight: | ||
+ | ** 146.122 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** D-glutamic acid | ||
+ | ** D-glu | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[D-ALANINE-AMINOTRANSFERASE-RXN]] |
== External links == | == External links == | ||
− | {{#set: common name= | + | * CAS : 6893-26-1 |
− | {{#set: reversible reaction associated= | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460297 5460297] | ||
+ | * HMDB : HMDB03339 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00217 C00217] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29986 29986] | ||
+ | * BIGG : glu__D | ||
+ | {{#set: smiles=C(CCC(C(=O)[O-])[N+])([O-])=O}} | ||
+ | {{#set: common name=D-glutamate}} | ||
+ | {{#set: inchi key=InChIKey=WHUUTDBJXJRKMK-GSVOUGTGSA-M}} | ||
+ | {{#set: molecular weight=146.122 }} | ||
+ | {{#set: common name=D-glutamic acid|D-glu}} | ||
+ | {{#set: reversible reaction associated=D-ALANINE-AMINOTRANSFERASE-RXN}} |
Latest revision as of 19:38, 21 March 2018
Contents
Metabolite D-GLT
- smiles:
- C(CCC(C(=O)[O-])[N+])([O-])=O
- common name:
- D-glutamate
- inchi key:
- InChIKey=WHUUTDBJXJRKMK-GSVOUGTGSA-M
- molecular weight:
- 146.122
- Synonym(s):
- D-glutamic acid
- D-glu
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CCC(C(=O)[O-])[N+])([O-])=O" cannot be used as a page name in this wiki.